Artorigidin C

ID: ALA1096730

PubChem CID: 46834559

Max Phase: Preclinical

Molecular Formula: C30H28O7

Molecular Weight: 500.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: Artorigidin C | Artorigidin C|CHEMBL1096730

Canonical SMILES:  C=C(C)c1cc2c(=O)c3c(O)c(CC=C(C)C)c(O)cc3oc2c2c1C(=O)C(O)=C(CC=C(C)C)C2=O

Standard InChI:  InChI=1S/C30H28O7/c1-13(2)7-9-16-20(31)12-21-23(25(16)32)27(34)19-11-18(15(5)6)22-24(30(19)37-21)26(33)17(10-8-14(3)4)28(35)29(22)36/h7-8,11-12,31-32,35H,5,9-10H2,1-4,6H3

Standard InChI Key:  DSVHQYRQFHXUGW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -2.3014   -7.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3026   -8.1232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5878   -8.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5896   -6.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8742   -7.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8734   -8.1190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1581   -8.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1638   -6.8780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5521   -7.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5539   -8.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2710   -8.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1563   -9.3550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5859   -9.3610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0160   -6.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0174   -8.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7315   -8.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4463   -8.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1605   -8.1209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4470   -9.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2675   -6.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7065   -6.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9806   -5.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2647   -6.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5484   -5.6282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4197   -5.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9885   -7.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9877   -8.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7055   -6.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9764   -4.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6887   -4.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6844   -3.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3967   -3.1366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9678   -3.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4205   -7.2759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7030   -8.5210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7048   -9.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4166   -8.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
  9  8  1  0
 17 18  1  0
  8  5  1  0
 17 19  1  0
  9 10  2  0
 20 26  2  0
 26 28  1  0
  5  4  2  0
 28 21  1  0
  4  1  1  0
 21 22  2  0
 22 23  1  0
 23 20  1  0
  9 20  1  0
 23 24  2  0
 10 11  1  0
 21 25  1  0
 26 27  1  0
 11 27  2  0
  2  3  1  0
  7 12  2  0
  5  6  1  0
 22 29  1  0
  3 13  1  0
 29 30  1  0
  3  6  2  0
 30 31  2  0
  1 14  1  0
 31 32  1  0
  6  7  1  0
 31 33  1  0
  2 15  1  0
 28 34  2  0
  7 10  1  0
 27 35  1  0
 15 16  1  0
 35 36  1  0
  1  2  2  0
 35 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA1096730

    ARTORIGIDIN C

Associated Targets(Human)

NFKB1 Tclin Nuclear factor NF-kappa-B p105 subunit (1459 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RELA Tchem Nuclear factor NF-kappa-B p65 subunit (627 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.55Molecular Weight (Monoisotopic): 500.1835AlogP: 6.45#Rotatable Bonds: 5
Polar Surface Area: 125.04Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.87CX Basic pKa: CX LogP: 6.38CX LogD: 3.30
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: 1.91

References

1. Ren Y, Kardono LB, Riswan S, Chai H, Farnsworth NR, Soejarto DD, Carcache de Blanco EJ, Kinghorn AD..  (2010)  Cytotoxic and NF-kappaB inhibitory constituents of Artocarpus rigida.,  73  (5): [PMID:20384315] [10.1021/np1002065]

Source