The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(Propane-1,3-diyl)bis(7-hydroxy-2-imino-2H-chromene-3-carboxamide) ID: ALA1096801
PubChem CID: 135891365
Max Phase: Preclinical
Molecular Formula: C23H20N4O6
Molecular Weight: 448.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=c1oc2cc(O)ccc2cc1C(=O)NCCCNC(=O)c1cc2ccc(O)cc2oc1=N
Standard InChI: InChI=1S/C23H20N4O6/c24-20-16(8-12-2-4-14(28)10-18(12)32-20)22(30)26-6-1-7-27-23(31)17-9-13-3-5-15(29)11-19(13)33-21(17)25/h2-5,8-11,24-25,28-29H,1,6-7H2,(H,26,30)(H,27,31)
Standard InChI Key: VLAVPACPOLPQDN-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
20.1137 -21.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1149 -22.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4005 -23.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4023 -21.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6874 -21.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6840 -22.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9692 -23.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2533 -22.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2567 -21.8475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9760 -21.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5381 -23.0857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5439 -21.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8286 -21.8431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5464 -20.6086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1158 -21.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4006 -21.8387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8277 -23.0955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6889 -21.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6877 -22.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4022 -23.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4004 -21.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1152 -21.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1186 -22.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8335 -23.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5494 -22.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5460 -21.8475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8267 -21.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2645 -23.0857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2588 -21.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9740 -21.8431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2562 -20.6086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6867 -21.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9749 -23.0955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
4 1 1 0
2 17 1 0
5 10 1 0
6 7 1 0
18 19 2 0
7 8 1 0
19 20 1 0
20 23 2 0
8 9 1 0
22 21 2 0
21 18 1 0
22 23 1 0
9 10 2 0
5 6 1 0
8 11 2 0
9 12 1 0
2 3 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
12 13 1 0
25 28 2 0
3 6 2 0
26 29 1 0
12 14 2 0
29 30 1 0
1 2 2 0
29 31 2 0
13 15 1 0
30 32 1 0
32 16 1 0
5 4 2 0
19 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.44Molecular Weight (Monoisotopic): 448.1383AlogP: 2.10#Rotatable Bonds: 6Polar Surface Area: 172.64Molecular Species: NEUTRALHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.47CX Basic pKa: 4.78CX LogP: 0.88CX LogD: 0.57Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.25Np Likeness Score: -0.16
References 1. Hill TA, Mariana A, Gordon CP, Odell LR, Robertson MJ, McGeachie AB, Chau N, Daniel JA, Gorgani NN, Robinson PJ, McCluskey A.. (2010) Iminochromene inhibitors of dynamins I and II GTPase activity and endocytosis., 53 (10): [PMID:20426422 ] [10.1021/jm100119c ] 2. (2012) Use of dynamin ring stabilizers,