toluene-4-sulphonic acid-2-[1,3-dioxo-1,3,3a,4,9,9a-hexahydro-4,9-benzeno-benz[f]isoindol-2-yl]-phenyl ester

ID: ALA1096902

PubChem CID: 46886852

Max Phase: Preclinical

Molecular Formula: C31H23NO5S

Molecular Weight: 521.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(OS(=O)(=O)c2ccccc2N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1

Standard InChI:  InChI=1S/C31H23NO5S/c1-18-14-16-19(17-15-18)37-38(35,36)25-13-7-6-12-24(25)32-30(33)28-26-20-8-2-3-9-21(20)27(29(28)31(32)34)23-11-5-4-10-22(23)26/h2-17,26-29H,1H3

Standard InChI Key:  LZYKFWRVXAMWMH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 44  0  0  0  0  0  0  0  0999 V2000
   18.4099   -2.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3928   -1.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0934   -0.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8080   -1.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8176   -2.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1164   -2.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7078   -2.4722    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.6778   -0.8450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6185   -0.1884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3958    0.9045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7785    0.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7896   -0.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0789   -0.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3568   -0.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3498    0.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0610    1.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1308    1.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3456    1.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7251    1.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8886    2.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6781    3.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2952    2.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4054   -0.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8902    0.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6774   -0.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8931   -1.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3374    0.4629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6426   -1.8810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7189   -3.2892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9942   -2.8764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2913   -1.7622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0168   -3.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3064   -3.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6049   -3.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3336   -4.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0323   -4.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6156   -4.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9011   -4.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  2  0
 10 24  1  0
 18 19  1  0
 19 20  2  0
  9 12  1  0
 20 21  1  0
  4  5  1  0
 21 22  2  0
 22 17  1  0
  9 18  1  0
 11 10  1  0
 23 24  1  0
 17 10  1  0
  2  3  1  0
  5  6  2  0
 11 12  2  0
 24 25  1  0
 25  8  1  0
  8 26  1  0
 26 23  1  0
  6  1  1  0
 25 27  2  0
 12 13  1  0
 26 28  2  0
  1  2  2  0
  7 29  1  0
 13 14  2  0
  7 30  2  0
  1  7  1  0
  7 31  2  0
 14 15  1  0
 29 32  1  0
  3  4  2  0
 32 33  2  0
 15 16  2  0
 33 34  1  0
 16 11  1  0
 34 37  2  0
  2  8  1  0
 37 35  1  0
 23  9  1  0
 35 36  2  0
 36 32  1  0
 37 38  1  0
M  END

Associated Targets(non-human)

Bacillus thuringiensis (718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.59Molecular Weight (Monoisotopic): 521.1297AlogP: 5.16#Rotatable Bonds: 4
Polar Surface Area: 80.75Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.76CX LogD: 5.76
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -0.63

References

1. Khalil AM, Berghot MA, Gouda MA..  (2010)  Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents.,  45  (4): [PMID:20117862] [10.1016/j.ejmech.2009.12.064]

Source