The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2,5-dimethyl-pyrrol-1-yl)-3-phenylamino-1H-pyrazole-4-carboxylic acid(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)-amide ID: ALA1096922
PubChem CID: 46193247
Max Phase: Preclinical
Molecular Formula: C25H26N6O2S
Molecular Weight: 474.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C)n1-c1[nH]nc(Nc2ccccc2)c1C(=O)Nc1sc2c(c1C(N)=O)CCCC2
Standard InChI: InChI=1S/C25H26N6O2S/c1-14-12-13-15(2)31(14)23-20(22(29-30-23)27-16-8-4-3-5-9-16)24(33)28-25-19(21(26)32)17-10-6-7-11-18(17)34-25/h3-5,8-9,12-13H,6-7,10-11H2,1-2H3,(H2,26,32)(H,28,33)(H2,27,29,30)
Standard InChI Key: DBNBFHZQRBXTHL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
6.1667 -0.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8787 -1.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8787 -0.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3744 -0.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5907 -0.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5917 -1.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3776 -1.5323 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.8596 -0.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7649 0.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5895 0.5526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3307 1.2288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6846 -0.8590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1000 -1.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6905 -2.2879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1571 -3.0167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5694 -3.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1548 -4.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5664 -5.1577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3922 -5.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8048 -4.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3909 -3.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2031 -1.9790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1984 -1.1467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4044 -0.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9206 -1.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4172 -2.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3857 -0.0699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0453 0.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7735 1.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9475 1.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7118 0.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8349 0.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9333 0.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27 16 1 0
5 6 1 0
16 17 1 0
7 8 1 0
17 18 2 0
8 9 1 0
18 19 1 0
9 5 2 0
19 20 2 0
6 4 1 0
20 21 1 0
5 10 1 0
21 22 2 0
22 17 1 0
24 25 1 0
6 7 2 0
10 11 1 0
10 12 2 0
1 2 1 0
23 24 1 0
25 26 2 0
26 27 1 0
27 23 2 0
9 13 1 0
25 28 1 0
29 30 2 0
1 4 1 0
13 14 1 0
14 26 1 0
2 3 1 0
28 29 1 0
30 31 1 0
31 32 2 0
32 28 1 0
14 15 2 0
29 33 1 0
3 7 1 0
32 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.59Molecular Weight (Monoisotopic): 474.1838AlogP: 4.85#Rotatable Bonds: 6Polar Surface Area: 117.83Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.36CX Basic pKa: 3.94CX LogP: 7.19CX LogD: 7.19Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.83
References 1. Gouda MA, Berghot MA, Abd El-Ghani GE, Khalil AM.. (2010) Synthesis and antimicrobial activities of some new thiazole and pyrazole derivatives based on 4,5,6,7-tetrahydrobenzothiophene moiety., 45 (4): [PMID:20064677 ] [10.1016/j.ejmech.2009.12.020 ]