The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cimicifugic acid M ID: ALA1096937
PubChem CID: 46210733
Max Phase: Preclinical
Molecular Formula: C20H18O9
Molecular Weight: 402.36
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Cimicifugic Acid M | Cimicifugic acid M|CHEMBL1096937|BDBM50316416
Canonical SMILES: O=C(/C=C/c1ccc(O)c(O)c1)O[C@H](C(=O)O)[C@](O)(Cc1ccccc1)C(=O)O
Standard InChI: InChI=1S/C20H18O9/c21-14-8-6-12(10-15(14)22)7-9-16(23)29-17(18(24)25)20(28,19(26)27)11-13-4-2-1-3-5-13/h1-10,17,21-22,28H,11H2,(H,24,25)(H,26,27)/b9-7+/t17-,20-/m1/s1
Standard InChI Key: RHQXHDXIEARXSC-DTLVDHMJSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
-3.5389 -10.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5401 -10.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8253 -11.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1088 -10.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1117 -10.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8271 -9.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3988 -9.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6837 -10.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0302 -9.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2708 -10.7333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2801 -10.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7001 -11.5798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5448 -10.8783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7462 -10.1481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0273 -8.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7403 -8.4983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6886 -8.5033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4591 -9.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1751 -10.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4560 -8.9079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8880 -9.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6040 -10.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6045 -10.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3197 -11.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0336 -10.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0278 -10.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3120 -9.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7501 -11.3628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7392 -9.7069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 7 1 0
9 15 1 1
3 4 2 0
15 16 2 0
7 8 1 0
15 17 1 0
14 18 1 0
8 9 1 0
18 19 1 0
4 5 1 0
18 20 2 0
8 10 1 6
19 21 2 0
2 3 1 0
21 22 1 0
8 11 1 0
22 23 2 0
5 6 2 0
23 24 1 0
11 12 2 0
24 25 2 0
6 1 1 0
25 26 1 0
11 13 1 0
26 27 2 0
27 22 1 0
1 2 2 0
25 28 1 0
9 14 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.36Molecular Weight (Monoisotopic): 402.0951AlogP: 1.17#Rotatable Bonds: 8Polar Surface Area: 161.59Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.28CX Basic pKa: ┄CX LogP: 2.69CX LogD: -3.36Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.25Np Likeness Score: 1.21
References 1. Iwanaga A, Kusano G, Warashina T, Miyase T.. (2010) Phenolic constituents of the aerial parts of Cimicifuga simplex and Cimicifuga japonica., 73 (4): [PMID:20184336 ] [10.1021/np900752t ]