2-(4-((1H-benzo[d]imidazol-2-yl)methyl)-1,4-diazepan-1-yl)-N-(2-fluorophenyl)acetamide

ID: ALA1097156

PubChem CID: 46888214

Max Phase: Preclinical

Molecular Formula: C21H24FN5O

Molecular Weight: 381.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CN1CCCN(Cc2nc3ccccc3[nH]2)CC1)Nc1ccccc1F

Standard InChI:  InChI=1S/C21H24FN5O/c22-16-6-1-2-7-17(16)25-21(28)15-27-11-5-10-26(12-13-27)14-20-23-18-8-3-4-9-19(18)24-20/h1-4,6-9H,5,10-15H2,(H,23,24)(H,25,28)

Standard InChI Key:  AFRZZUAHLZKARG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    6.1756   -1.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1817   -2.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8989   -2.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8813   -1.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5997   -1.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6114   -2.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8721   -1.8487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3885   -1.1887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7119   -1.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1738   -2.5353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0009   -2.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5831   -2.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7609   -3.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5329   -3.8080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0604   -4.0226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8482   -4.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2482   -4.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9630   -3.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9630   -2.9841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3919   -3.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1074   -4.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8148   -3.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8148   -2.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1010   -2.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3893   -2.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1074   -5.0554    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.4003   -2.5254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6774   -4.2209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  7  8  2  0
  8  5  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 21 26  1  0
  1  2  2  0
  6 27  1  0
 27  7  1  0
 18 28  1  0
 28 20  1  0
M  END

Associated Targets(Human)

CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 381.45Molecular Weight (Monoisotopic): 381.1965AlogP: 2.85#Rotatable Bonds: 5
Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.21CX Basic pKa: 6.52CX LogP: 2.24CX LogD: 2.18
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.71Np Likeness Score: -2.34

References

1. Gu SJ, Lee JK, Pae AN, Chung HJ, Rhim H, Han SY, Min SJ, Cho YS..  (2010)  Synthesis and biological evaluation of 1,4-diazepane derivatives as T-type calcium channel blockers.,  20  (9): [PMID:20382529] [10.1016/j.bmcl.2010.03.084]

Source