The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2',4'-difluoro-5'-(methylsulfonyl)biphenyl-3-yl)-3-methyl-8-(trifluoromethyl)quinoline ID: ALA1097159
PubChem CID: 46887890
Max Phase: Preclinical
Molecular Formula: C24H16F5NO2S
Molecular Weight: 477.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(-c2cc(S(C)(=O)=O)c(F)cc2F)c1
Standard InChI: InChI=1S/C24H16F5NO2S/c1-13-12-30-23-16(7-4-8-18(23)24(27,28)29)22(13)15-6-3-5-14(9-15)17-10-21(33(2,31)32)20(26)11-19(17)25/h3-12H,1-2H3
Standard InChI Key: GKRQECRQGLCHTJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-5.4514 -11.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4526 -11.9982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7378 -12.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7396 -10.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0242 -11.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0234 -11.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3081 -12.4050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5931 -11.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5979 -11.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3138 -10.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3187 -9.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6048 -9.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6088 -8.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3260 -8.2837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0406 -8.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0331 -9.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8952 -8.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1784 -8.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4664 -8.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4700 -7.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1915 -7.0398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9005 -7.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7359 -13.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4494 -13.6502 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.0204 -13.6469 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.7417 -14.0583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.1983 -6.2185 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.4873 -5.8036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0000 -6.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6167 -5.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8859 -10.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2419 -7.0318 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.1753 -9.5148 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16 11 1 0
10 11 1 0
7 8 2 0
5 4 2 0
17 18 2 0
8 9 1 0
18 19 1 0
4 1 1 0
19 20 2 0
9 10 2 0
20 21 1 0
10 5 1 0
21 22 2 0
22 17 1 0
13 17 1 0
3 23 1 0
2 3 1 0
23 24 1 0
11 12 2 0
23 25 1 0
5 6 1 0
23 26 1 0
12 13 1 0
21 27 1 0
3 6 2 0
27 28 1 0
13 14 2 0
27 29 2 0
6 7 1 0
27 30 2 0
14 15 1 0
9 31 1 0
1 2 2 0
20 32 1 0
15 16 2 0
18 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.45Molecular Weight (Monoisotopic): 477.0822AlogP: 6.58#Rotatable Bonds: 3Polar Surface Area: 47.03Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.56CX LogP: 5.94CX LogD: 5.94Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.25Np Likeness Score: -1.03
References 1. Ullrich JW, Morris R, Bernotas RC, Travins JM, Jetter J, Unwalla R, Quinet E, Nambi P, Feingold I, Huselton C, Enroth C, Wilhelmsson A, Goos-Nilsson A, Wrobel J.. (2010) Synthesis of 4-(3-biaryl)quinoline sulfones as potent liver X receptor agonists., 20 (9): [PMID:20382019 ] [10.1016/j.bmcl.2010.03.031 ]