The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-acetyl-phenyl]-3a,4,9,9a-tetrahydro-4,9-benzeno-benz[f]isoindole-1,3-dione ID: ALA1097223
Cas Number: 293324-34-2
PubChem CID: 3094529
Max Phase: Preclinical
Molecular Formula: C26H19NO3
Molecular Weight: 393.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1ccc(N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1
Standard InChI: InChI=1S/C26H19NO3/c1-14(28)15-10-12-16(13-11-15)27-25(29)23-21-17-6-2-3-7-18(17)22(24(23)26(27)30)20-9-5-4-8-19(20)21/h2-13,21-24H,1H3
Standard InChI Key: NRGNXWCMEFDWEF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 35 0 0 0 0 0 0 0 0999 V2000
-1.5310 -0.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8530 0.2099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0789 0.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1490 -0.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1604 -1.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5426 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2547 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2595 -0.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5559 0.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9592 -1.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9529 -2.2626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6698 -1.0425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5772 1.6429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5602 -1.0620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1704 0.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8894 1.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5394 1.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9981 0.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6935 1.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0054 2.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0612 3.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8045 3.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4931 2.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4338 2.1192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7984 0.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0253 0.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8275 1.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4036 0.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1720 -0.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3703 -0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 14 2 0
15 16 1 0
2 3 1 0
6 7 2 0
16 17 1 0
18 15 1 0
3 16 1 0
17 20 1 0
7 8 1 0
25 18 1 0
15 1 1 0
8 9 2 0
19 20 2 0
9 4 1 0
20 21 1 0
2 4 1 0
21 22 2 0
7 10 1 0
22 23 1 0
23 24 2 0
24 19 1 0
10 11 2 0
4 5 2 0
25 26 2 0
10 12 1 0
26 27 1 0
1 2 1 0
27 28 2 0
3 13 2 0
28 29 1 0
5 6 1 0
29 30 2 0
30 25 1 0
17 26 1 0
19 18 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.44Molecular Weight (Monoisotopic): 393.1365AlogP: 4.29#Rotatable Bonds: 2Polar Surface Area: 54.45Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.58CX LogD: 3.58Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -0.58
References 1. Khalil AM, Berghot MA, Gouda MA.. (2010) Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents., 45 (4): [PMID:20117862 ] [10.1016/j.ejmech.2009.12.064 ]