2-[4-acetyl-phenyl]-3a,4,9,9a-tetrahydro-4,9-benzeno-benz[f]isoindole-1,3-dione

ID: ALA1097223

Cas Number: 293324-34-2

PubChem CID: 3094529

Max Phase: Preclinical

Molecular Formula: C26H19NO3

Molecular Weight: 393.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1ccc(N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1

Standard InChI:  InChI=1S/C26H19NO3/c1-14(28)15-10-12-16(13-11-15)27-25(29)23-21-17-6-2-3-7-18(17)22(24(23)26(27)30)20-9-5-4-8-19(20)21/h2-13,21-24H,1H3

Standard InChI Key:  NRGNXWCMEFDWEF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 35  0  0  0  0  0  0  0  0999 V2000
   -1.5310   -0.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8530    0.2099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0789    0.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1490   -0.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1604   -1.0190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5426   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2547   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2595   -0.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5559    0.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9592   -1.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9529   -2.2626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6698   -1.0425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5772    1.6429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5602   -1.0620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1704    0.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8894    1.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5394    1.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9981    0.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6935    1.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0054    2.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0612    3.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8045    3.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4931    2.9421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4338    2.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7984    0.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0253    0.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8275    1.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4036    0.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1720   -0.3531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3703   -0.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 14  2  0
 15 16  1  0
  2  3  1  0
  6  7  2  0
 16 17  1  0
 18 15  1  0
  3 16  1  0
 17 20  1  0
  7  8  1  0
 25 18  1  0
 15  1  1  0
  8  9  2  0
 19 20  2  0
  9  4  1  0
 20 21  1  0
  2  4  1  0
 21 22  2  0
  7 10  1  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 10 11  2  0
  4  5  2  0
 25 26  2  0
 10 12  1  0
 26 27  1  0
  1  2  1  0
 27 28  2  0
  3 13  2  0
 28 29  1  0
  5  6  1  0
 29 30  2  0
 30 25  1  0
 17 26  1  0
 19 18  1  0
M  END

Associated Targets(non-human)

Bacillus thuringiensis (718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 393.44Molecular Weight (Monoisotopic): 393.1365AlogP: 4.29#Rotatable Bonds: 2
Polar Surface Area: 54.45Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.58CX LogD: 3.58
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -0.58

References

1. Khalil AM, Berghot MA, Gouda MA..  (2010)  Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents.,  45  (4): [PMID:20117862] [10.1016/j.ejmech.2009.12.064]

Source