2-[3-cyclopentyl-2-(3,4-dichlorophenyl)-propionylamino]-thiazole-4-carboxylic acid ethyl ester

ID: ALA1097399

PubChem CID: 46221596

Max Phase: Preclinical

Molecular Formula: C20H22Cl2N2O3S

Molecular Weight: 441.38

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1csc(NC(=O)C(CC2CCCC2)c2ccc(Cl)c(Cl)c2)n1

Standard InChI:  InChI=1S/C20H22Cl2N2O3S/c1-2-27-19(26)17-11-28-20(23-17)24-18(25)14(9-12-5-3-4-6-12)13-7-8-15(21)16(22)10-13/h7-8,10-12,14H,2-6,9H2,1H3,(H,23,24,25)

Standard InChI Key:  ZFMHSESQCGNGBP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    1.2601  -22.1056    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.1711  -21.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9255  -20.9500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4785  -21.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0660  -22.2780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2966  -21.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7854  -22.1469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6341  -20.7230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4595  -20.8751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2564  -21.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2564  -22.1125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9722  -20.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9722  -20.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6839  -21.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6839  -22.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3996  -22.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1155  -22.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1155  -21.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3996  -20.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8271  -22.5250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.3996  -23.3499    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.2564  -19.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1716  -18.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6344  -18.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0468  -19.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4980  -19.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4564  -20.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7898  -19.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  1  5  1  0
  6  7  2  0
  6  8  1  0
  4  6  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
 17 20  1  0
 16 21  1  0
 12 14  1  0
  9 10  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 22 26  1  0
 13 22  1  0
  2  9  1  0
 27 28  1  0
  8 27  1  0
M  END

Associated Targets(Human)

GCKR Tchem Glucokinase regulatory protein (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.38Molecular Weight (Monoisotopic): 440.0728AlogP: 5.93#Rotatable Bonds: 7
Polar Surface Area: 68.29Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.84CX Basic pKa: CX LogP: 6.29CX LogD: 6.16
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -1.32

References

1. Haynes NE, Corbett WL, Bizzarro FT, Guertin KR, Hilliard DW, Holland GW, Kester RF, Mahaney PE, Qi L, Spence CL, Tengi J, Dvorozniak MT, Railkar A, Matschinsky FM, Grippo JF, Grimsby J, Sarabu R..  (2010)  Discovery, structure-activity relationships, pharmacokinetics, and efficacy of glucokinase activator (2R)-3-cyclopentyl-2-(4-methanesulfonylphenyl)-N-thiazol-2-yl-propionamide (RO0281675).,  53  (9): [PMID:20405948] [10.1021/jm100039a]

Source