(S)-2-Amino-N-((S)-1-(2-(hydroxyamino)-2-oxoethyl)-2,6-dioxopiperidin-3-yl)propanamide hydrochloride

ID: ALA1097589

PubChem CID: 44481936

Max Phase: Preclinical

Molecular Formula: C10H17ClN4O5

Molecular Weight: 272.26

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](N)C(=O)N[C@H]1CCC(=O)N(CC(=O)NO)C1=O.Cl

Standard InChI:  InChI=1S/C10H16N4O5.ClH/c1-5(11)9(17)12-6-2-3-8(16)14(10(6)18)4-7(15)13-19;/h5-6,19H,2-4,11H2,1H3,(H,12,17)(H,13,15);1H/t5-,6-;/m0./s1

Standard InChI Key:  GAUNQBCQLNVNGW-GEMLJDPKSA-N

Molfile:  

     RDKit          2D

 20 19  0  0  0  0  0  0  0  0999 V2000
   16.8477    1.0537    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.4508    0.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1663    0.6845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7353    0.6845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8819    0.2738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1663    1.5101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5974    0.6845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3080    0.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0172    0.6795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0215    1.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3102    1.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5906    1.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3050   -0.5533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7385    1.9176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7312    0.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4483    0.6741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1623    0.2607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4514    1.4997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4508   -0.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8741    0.6705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 13  2  0
  7  5  1  1
 10 14  2  0
  7  8  1  0
  9 15  1  0
  2  4  1  0
 15 16  1  0
 16 17  1  0
  3  5  1  0
 16 18  2  0
  2  3  1  0
  2 19  1  6
  3  6  2  0
 17 20  1  0
  7 12  1  0
  8  9  1  0
M  END

Associated Targets(Human)

ANPEP Tchem Aminopeptidase N (863 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 272.26Molecular Weight (Monoisotopic): 272.1121AlogP: -2.53#Rotatable Bonds: 4
Polar Surface Area: 141.83Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 8.75CX Basic pKa: 8.00CX LogP: -3.58CX LogD: -3.95
Aromatic Rings: Heavy Atoms: 19QED Weighted: 0.25Np Likeness Score: -0.48

References

1. Li Q, Fang H, Wang X, Xu W..  (2010)  Novel cyclic-imide peptidomimetics as aminopeptidase N inhibitors. Structure-based design, chemistry and activity evaluation. II.,  45  (4): [PMID:20129718] [10.1016/j.ejmech.2009.12.071]
2. Chen, H H, Noble, F F, Roques, B P BP and Fournié-Zaluski, M C MC.  2001-10-11  Long lasting antinociceptive properties of enkephalin degrading enzyme (NEP and APN) inhibitor prodrugs.  [PMID:11585456]
3. Vassiliou, Stamatia S and 7 more authors.  2014-10-09  Structure-guided, single-point modifications in the phosphinic dipeptide structure yield highly potent and selective inhibitors of neutral aminopeptidases.  [PMID:25192493]
4. Węglarz-Tomczak, Ewelina and 5 more authors.  2016-07-19  A structural insight into the P1S1 binding mode of diaminoethylphosphonic and phosphinic acids, selective inhibitors of alanine aminopeptidases.  [PMID:27100031]
5. Singh, Rohit R, Williams, Jessica J and Vince, Robert R.  2017-10-20  Puromycin based inhibitors of aminopeptidases for the potential treatment of hematologic malignancies.  [PMID:28803047]
6. Pascual, Isel and 10 more authors.  2017-11  Discovery of novel non-competitive inhibitors of mammalian neutral M1 aminopeptidase (APN).  [PMID:28964831]

Source