5-cyclohexyl-3-stearoylpyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione

ID: ALA1097793

PubChem CID: 46888360

Max Phase: Preclinical

Molecular Formula: C29H47N3O3

Molecular Weight: 485.71

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCCCC(=O)c1n[nH]c2c1C(=O)N(C1CCCCC1)C2=O

Standard InChI:  InChI=1S/C29H47N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-24(33)26-25-27(31-30-26)29(35)32(28(25)34)23-20-17-16-18-21-23/h23H,2-22H2,1H3,(H,30,31)

Standard InChI Key:  VKOSWMSSZOPXEJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   -2.3180  -13.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3254  -12.4496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8074  -13.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5391  -12.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5401  -13.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7496  -13.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2719  -13.1047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4833  -14.5597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0691  -15.1441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5881  -11.6705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5663  -14.5682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2301  -14.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9441  -14.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6580  -14.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3720  -14.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0860  -14.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000  -14.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5139  -14.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2279  -14.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9419  -14.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6559  -14.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3699  -14.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0838  -14.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7978  -14.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5118  -14.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2258  -14.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9397  -14.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6537  -14.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6341  -13.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0533  -12.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8764  -12.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2875  -13.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8693  -13.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0398  -13.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7576  -12.4378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  2  0
 16 17  1  0
  5  6  1  0
 17 18  1  0
  6  7  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  6  8  1  0
 21 22  1  0
  8  9  2  0
 22 23  1  0
  2 10  2  0
 23 24  1  0
  1 11  2  0
 24 25  1  0
 25 26  1  0
  8 12  1  0
 26 27  1  0
  1  5  1  0
 27 28  1  0
 12 13  1  0
  3 29  1  0
 29 30  1  0
  4  2  1  0
 13 14  1  0
  2  3  1  0
 14 15  1  0
  3  1  1  0
 29 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 15 16  1  0
  7 35  1  0
 35  4  1  0
M  END

Associated Targets(Human)

CDC25B Tchem Dual specificity phosphatase Cdc25B (1099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.71Molecular Weight (Monoisotopic): 485.3617AlogP: 7.78#Rotatable Bonds: 18
Polar Surface Area: 83.13Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.53CX Basic pKa: CX LogP: 8.25CX LogD: 8.22
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.13Np Likeness Score: -0.27

References

1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ..  (2010)  Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B.,  20  (9): [PMID:20363629] [10.1016/j.bmcl.2010.03.040]

Source