5-(naphthalen-1-yl)-3-stearoylpyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione

ID: ALA1097794

PubChem CID: 46888361

Max Phase: Preclinical

Molecular Formula: C33H43N3O3

Molecular Weight: 529.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCCCC(=O)c1n[nH]c2c1C(=O)N(c1cccc3ccccc13)C2=O

Standard InChI:  InChI=1S/C33H43N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-24-28(37)30-29-31(35-34-30)33(39)36(32(29)38)27-23-19-21-25-20-17-18-22-26(25)27/h17-23H,2-16,24H2,1H3,(H,34,35)

Standard InChI Key:  CUXFSZAQUDTRFE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   -3.6889  -16.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5199  -16.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9318  -17.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2742  -17.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6861  -18.0956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5171  -18.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9290  -18.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5141  -19.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6833  -19.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2714  -18.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9587  -18.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9661  -16.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4482  -17.3738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1799  -16.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1809  -17.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3904  -18.0235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0875  -17.3551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1241  -18.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7099  -19.3946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2288  -15.9211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2071  -18.8187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5894  -19.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3034  -18.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0174  -19.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7313  -18.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4453  -19.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1593  -18.7947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8733  -19.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5872  -18.7905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3012  -19.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0152  -18.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7292  -19.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4432  -18.7822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1571  -19.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8711  -18.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5851  -19.1871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2991  -18.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0130  -19.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3984  -16.6883    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 12 20  2  0
 11 21  2  0
 10  5  2  0
 18 22  1  0
 22 23  1  0
  1  2  1  0
 23 24  1  0
  2  3  2  0
 24 25  1  0
  3  6  1  0
 25 26  1  0
  5  4  1  0
 26 27  1  0
  4  1  2  0
 27 28  1  0
  5  6  1  0
 28 29  1  0
  6  7  2  0
 29 30  1  0
  7  8  1  0
 30 31  1  0
  8  9  2  0
 31 32  1  0
  9 10  1  0
 32 33  1  0
 11 15  1  0
 33 34  1  0
 14 12  1  0
 34 35  1  0
 12 13  1  0
 35 36  1  0
 13 11  1  0
 36 37  1  0
 14 15  2  0
 37 38  1  0
 13  4  1  0
 15 16  1  0
 17 39  1  0
 39 14  1  0
M  END

Associated Targets(Human)

CDC25B Tchem Dual specificity phosphatase Cdc25B (1099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.73Molecular Weight (Monoisotopic): 529.3304AlogP: 8.81#Rotatable Bonds: 18
Polar Surface Area: 83.13Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 5.13CX Basic pKa: CX LogP: 9.10CX LogD: 7.57
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.10Np Likeness Score: -0.44

References

1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ..  (2010)  Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B.,  20  (9): [PMID:20363629] [10.1016/j.bmcl.2010.03.040]

Source