The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,6-difluoro-4-(2-(phenylsulfonamido)ethylthio)phenoxy)acetamide ID: ALA1097940
Cas Number: 141286-78-4
PubChem CID: 6603828
Product Number: P335717, Order Now?
Max Phase: Preclinical
Molecular Formula: C16H16F2N2O4S2
Molecular Weight: 402.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)COc1c(F)cc(SCCNS(=O)(=O)c2ccccc2)cc1F
Standard InChI: InChI=1S/C16H16F2N2O4S2/c17-13-8-11(9-14(18)16(13)24-10-15(19)21)25-7-6-20-26(22,23)12-4-2-1-3-5-12/h1-5,8-9,20H,6-7,10H2,(H2,19,21)
Standard InChI Key: GTACSIONMHMRPD-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
-0.6727 4.8982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0418 4.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7562 4.8982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0418 3.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7562 3.2482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7562 2.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4707 2.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1852 2.4232 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4707 1.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7562 0.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7562 -0.0518 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0418 -0.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0418 -1.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6727 -1.7018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6727 -2.5268 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.4977 -2.5268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1523 -2.5268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6727 -3.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3872 -3.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3872 -4.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6727 -5.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0418 -4.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0418 -3.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0418 1.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0418 2.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6727 2.4232 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
2 4 1 0
4 5 1 0
6 5 1 0
6 7 2 0
6 25 1 0
7 8 1 0
7 9 1 0
9 10 2 0
10 11 1 0
10 24 1 0
12 11 1 0
12 13 1 0
13 14 1 0
14 15 1 0
16 15 2 0
17 15 2 0
18 15 1 0
18 23 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
24 25 2 0
25 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.44Molecular Weight (Monoisotopic): 402.0520AlogP: 1.90#Rotatable Bonds: 9Polar Surface Area: 98.49Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.18CX Basic pKa: ┄CX LogP: 1.77CX LogD: 1.77Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.49Np Likeness Score: -1.82
References 1. Fleming JJ, England PM.. (2010) Developing a complete pharmacology for AMPA receptors: a perspective on subtype-selective ligands., 18 (4): [PMID:20096591 ] [10.1016/j.bmc.2009.12.072 ] 2. Diamandis P, Wildenhain J, Clarke ID, Sacher AG, Graham J, Bellows DS, Ling EK, Ward RJ, Jamieson LG, Tyers M, Dirks PB.. (2007) Chemical genetics reveals a complex functional ground state of neural stem cells., 3 (5): [PMID:17417631 ] [10.1038/nchembio873 ] 3. PubChem BioAssay data set, 4. PubChem BioAssay data set, 5. PubChem BioAssay data set, 6. PubChem BioAssay data set,