2-(5-{[(2S)-2-Amino-3-(3,4-dichlorophenyl)propyl]oxy}pyridin-3-yl)-8,9-dimethoxybenzo[c]-2,7-naphthyridin-4-amine

ID: ALA1097972

PubChem CID: 46193132

Max Phase: Preclinical

Molecular Formula: C28H25Cl2N5O3

Molecular Weight: 550.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2ncc3c(N)nc(-c4cncc(OC[C@@H](N)Cc5ccc(Cl)c(Cl)c5)c4)cc3c2cc1OC

Standard InChI:  InChI=1S/C28H25Cl2N5O3/c1-36-26-9-20-19-8-24(35-28(32)21(19)13-34-25(20)10-27(26)37-2)16-7-18(12-33-11-16)38-14-17(31)5-15-3-4-22(29)23(30)6-15/h3-4,6-13,17H,5,14,31H2,1-2H3,(H2,32,35)/t17-/m0/s1

Standard InChI Key:  UUQADGWFQPYANC-KRWDZBQOSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -4.0123   -1.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0137   -2.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3014   -3.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3034   -1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5860   -1.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5869   -2.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8701   -3.0750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1479   -2.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8684   -1.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1460   -1.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4227   -1.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4156   -0.5839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1380   -0.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8675   -0.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2880   -1.8374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1323    0.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4113    1.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4054    1.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1168    2.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8356    1.9003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8382    1.0783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114    2.3010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0220    1.8838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7388    2.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4494    1.8733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7449    3.1147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7265   -1.4199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4399   -1.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7279   -3.0692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4411   -2.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1662    2.2801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8789    1.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5952    2.2620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6017    3.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8859    3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1726    3.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3056    1.8444    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.3178    3.4948    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  8 10  1  0
 18 19  2  0
  9 10  2  0
 19 20  1  0
  5  4  2  0
 20 21  2  0
 21 16  1  0
  4  1  1  0
 18 22  1  0
  5  6  1  0
 22 23  1  0
 23 24  1  0
  2  3  1  0
 24 25  1  1
  3  6  2  0
 24 26  1  0
  9 14  1  0
  1 27  1  0
 10 11  1  0
 27 28  1  0
 11 12  2  0
  2 29  1  0
 12 13  1  0
 29 30  1  0
 13 14  2  0
 25 31  1  0
  1  2  2  0
 31 32  2  0
 11 15  1  0
 32 33  1  0
  5  9  1  0
 33 34  2  0
 13 16  1  0
 34 35  1  0
  6  7  1  0
 35 36  2  0
 36 31  1  0
 16 17  2  0
 33 37  1  0
  7  8  2  0
 34 38  1  0
M  END

Associated Targets(Human)

PDPK1 Tchem 3-phosphoinositide dependent protein kinase-1 (3758 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AKT1 Tchem Serine/threonine-protein kinase AKT (9192 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RPS6KB1 Tchem Ribosomal protein S6 kinase 1 (4456 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.45Molecular Weight (Monoisotopic): 549.1334AlogP: 5.70#Rotatable Bonds: 8
Polar Surface Area: 118.40Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.26CX LogP: 4.49CX LogD: 2.63
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.62

References

1. Nittoli T, Dushin RG, Ingalls C, Cheung K, Floyd MB, Fraser H, Olland A, Hu Y, Grosu G, Han X, Arndt K, Guo B, Wissner A..  (2010)  The identification of 8,9-dimethoxy-5-(2-aminoalkoxy-pyridin-3-yl)-benzo[c][2,7]naphthyridin-4-ylamines as potent inhibitors of 3-phosphoinositide-dependent kinase-1 (PDK-1).,  45  (4): [PMID:20074837] [10.1016/j.ejmech.2009.12.036]

Source