The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((1,3,6,7-Tetramethoxyxanthone-4-yl)-sulfonyl)-4-(3-methyl-phenyl)-piperazine ID: ALA1098073
PubChem CID: 46830279
Max Phase: Preclinical
Molecular Formula: C28H30N2O8S
Molecular Weight: 554.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2oc3c(S(=O)(=O)N4CCN(c5cccc(C)c5)CC4)c(OC)cc(OC)c3c(=O)c2cc1OC
Standard InChI: InChI=1S/C28H30N2O8S/c1-17-7-6-8-18(13-17)29-9-11-30(12-10-29)39(32,33)28-24(37-5)16-23(36-4)25-26(31)19-14-21(34-2)22(35-3)15-20(19)38-27(25)28/h6-8,13-16H,9-12H2,1-5H3
Standard InChI Key: XWJNCLRJWKWPRX-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-1.9763 1.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4018 2.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2322 2.0689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6290 1.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1514 1.3905 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.0027 2.8079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1778 2.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4539 1.3301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8806 2.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3769 0.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2044 0.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6047 -0.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9497 -0.0513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4296 -0.0890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3545 -0.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1797 -0.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5826 -1.5021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1616 -2.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3333 -2.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9341 -1.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5641 -2.9317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3890 -2.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9094 -2.9062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3103 -3.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7270 0.6830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7458 2.1083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5708 2.1083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1275 -0.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7066 -0.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1187 -0.7346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5213 -0.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0986 0.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5404 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1364 -2.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5575 -2.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3833 -2.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7862 -2.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3628 -1.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6111 -2.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
8 9 1 0
19 20 2 0
20 15 1 0
10 11 2 0
18 21 1 0
4 11 1 0
21 22 1 0
1 2 2 0
19 23 1 0
1 5 1 0
23 24 1 0
10 1 1 0
5 25 1 0
10 13 1 0
5 26 2 0
11 12 1 0
5 27 2 0
25 28 1 0
12 16 1 0
15 13 1 0
2 6 1 0
12 14 2 0
2 3 1 0
25 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
6 7 1 0
30 33 1 0
15 16 2 0
33 34 2 0
34 35 1 0
16 17 1 0
35 36 2 0
4 8 1 0
36 37 1 0
17 18 2 0
37 38 2 0
38 33 1 0
3 4 2 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.62Molecular Weight (Monoisotopic): 554.1723AlogP: 3.80#Rotatable Bonds: 7Polar Surface Area: 107.75Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.62CX LogP: 3.63CX LogD: 3.63Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: -0.50
References 1. Hu H, Liao H, Zhang J, Wu W, Yan J, Yan Y, Zhao Q, Zou Y, Chai X, Yu S, Wu Q.. (2010) First identification of xanthone sulfonamides as potent acyl-CoA:cholesterol acyltransferase (ACAT) inhibitors., 20 (10): [PMID:20403694 ] [10.1016/j.bmcl.2010.03.101 ]