The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-bromophenyl)-N-(4-methoxyphenyl)-5-(4-methyl-2-pivalamidothiazol-5-yl)-1H-pyrazole-3-carboxamide ID: ALA1098166
PubChem CID: 46221405
Max Phase: Preclinical
Molecular Formula: C26H26BrN5O3S
Molecular Weight: 568.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC(=O)c2cc(-c3sc(NC(=O)C(C)(C)C)nc3C)n(-c3ccc(Br)cc3)n2)cc1
Standard InChI: InChI=1S/C26H26BrN5O3S/c1-15-22(36-25(28-15)30-24(34)26(2,3)4)21-14-20(31-32(21)18-10-6-16(27)7-11-18)23(33)29-17-8-12-19(35-5)13-9-17/h6-14H,1-5H3,(H,29,33)(H,28,30,34)
Standard InChI Key: TVFKIHOEEAGATR-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
8.5500 -0.9394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3482 -0.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3981 0.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6274 0.3945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1072 -0.2447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0933 0.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8256 0.1575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0561 1.3615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7512 1.8058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4822 1.4242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1769 1.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1401 2.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4028 3.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7111 2.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8347 3.1381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5675 2.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2826 -0.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8598 0.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0357 0.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6364 -0.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0672 -1.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8899 -0.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8116 -0.3102 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
8.2484 -1.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4500 -1.9134 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.4009 -2.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1690 -3.0381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6927 -2.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5162 -2.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7058 -3.1813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7431 -4.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0480 -4.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4755 -4.3852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3156 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0852 -5.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -4.8733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
17 18 2 0
8 9 1 0
18 19 1 0
4 5 1 0
19 20 2 0
9 10 2 0
20 21 1 0
5 1 1 0
21 22 2 0
22 17 1 0
10 11 1 0
20 23 1 0
24 25 1 0
1 2 2 0
11 12 2 0
3 6 1 0
12 13 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 2 0
1 24 1 0
13 14 2 0
28 29 1 0
14 9 1 0
26 30 1 0
6 7 2 0
30 31 1 0
12 15 1 0
31 32 1 0
2 3 1 0
31 33 2 0
15 16 1 0
32 34 1 0
6 8 1 0
32 35 1 0
5 17 1 0
32 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.50Molecular Weight (Monoisotopic): 567.0940AlogP: 6.31#Rotatable Bonds: 6Polar Surface Area: 98.14Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.90CX Basic pKa: ┄CX LogP: 6.22CX LogD: 6.11Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -1.77
References 1. Ye L, Knapp JM, Sangwung P, Fettinger JC, Verkman AS, Kurth MJ.. (2010) Pyrazolylthiazole as DeltaF508-cystic fibrosis transmembrane conductance regulator correctors with improved hydrophilicity compared to bithiazoles., 53 (9): [PMID:20373765 ] [10.1021/jm100235h ] 2. Liessi N, Cichero E, Pesce E, Arkel M, Salis A, Tomati V, Paccagnella M, Damonte G, Tasso B, Galietta LJV, Pedemonte N, Fossa P, Millo E.. (2018) Synthesis and biological evaluation of novel thiazole- VX-809 hybrid derivatives as F508del correctors by QSAR-based filtering tools., 144 [PMID:29272749 ] [10.1016/j.ejmech.2017.12.030 ]