2-(4-((1H-benzo[d]imidazol-2-yl)methyl)-1,4-diazepan-1-yl)-N-(2,4-dimethylphenyl)acetamide

ID: ALA1098196

PubChem CID: 46888211

Max Phase: Preclinical

Molecular Formula: C23H29N5O

Molecular Weight: 391.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)CN2CCCN(Cc3nc4ccccc4[nH]3)CC2)c(C)c1

Standard InChI:  InChI=1S/C23H29N5O/c1-17-8-9-19(18(2)14-17)26-23(29)16-28-11-5-10-27(12-13-28)15-22-24-20-6-3-4-7-21(20)25-22/h3-4,6-9,14H,5,10-13,15-16H2,1-2H3,(H,24,25)(H,26,29)

Standard InChI Key:  HSTQJTFPJOFGGJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    6.1381    3.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1182    2.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8224    2.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8565    3.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5575    3.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5438    2.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8319    2.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3542    3.5730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6577    2.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1225    2.1896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9394    2.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5381    1.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7096    1.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4814    0.9192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0090    0.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7967    0.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1977    0.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9120    0.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9104    1.7461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3430    0.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0523    0.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7632    0.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7634    1.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0499    2.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3376    1.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0540   -0.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4782    2.1590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3244    2.2374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6283    0.5124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  7  8  2  0
  8  5  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 21 26  1  0
 23 27  1  0
  1  2  2  0
  6 28  1  0
 28  7  1  0
 18 29  1  0
 29 20  1  0
M  END

Associated Targets(Human)

CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 391.52Molecular Weight (Monoisotopic): 391.2372AlogP: 3.33#Rotatable Bonds: 5
Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.48CX Basic pKa: 6.82CX LogP: 3.12CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -2.27

References

1. Gu SJ, Lee JK, Pae AN, Chung HJ, Rhim H, Han SY, Min SJ, Cho YS..  (2010)  Synthesis and biological evaluation of 1,4-diazepane derivatives as T-type calcium channel blockers.,  20  (9): [PMID:20382529] [10.1016/j.bmcl.2010.03.084]

Source