2-(4-((1H-benzo[d]imidazol-2-yl)methyl)-1,4-diazepan-1-yl)-N-(2,6-dimethylphenyl)acetamide

ID: ALA1098198

PubChem CID: 46888213

Max Phase: Preclinical

Molecular Formula: C23H29N5O

Molecular Weight: 391.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1NC(=O)CN1CCCN(Cc2nc3ccccc3[nH]2)CC1

Standard InChI:  InChI=1S/C23H29N5O/c1-17-7-5-8-18(2)23(17)26-22(29)16-28-12-6-11-27(13-14-28)15-21-24-19-9-3-4-10-20(19)25-21/h3-5,7-10H,6,11-16H2,1-2H3,(H,24,25)(H,26,29)

Standard InChI Key:  PDGKXQYCWYRWOA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -4.4200   -2.8851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4149   -3.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6981   -4.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7136   -2.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9958   -2.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9852   -3.7010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7238   -3.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2065   -2.6066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8836   -3.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4217   -3.9552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4056   -3.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9878   -4.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8346   -4.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9376   -5.2279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5349   -5.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2527   -5.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6531   -5.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3681   -5.2283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3681   -4.4037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7970   -5.2283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5125   -5.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2196   -5.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2196   -4.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5061   -4.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7941   -4.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5125   -6.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0776   -3.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1966   -3.9433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0825   -5.6408    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  7  8  2  0
  8  5  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 21 26  1  0
 25 27  1  0
  1  2  2  0
  6 28  1  0
 28  7  1  0
 18 29  1  0
 29 20  1  0
M  END

Associated Targets(Human)

CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 391.52Molecular Weight (Monoisotopic): 391.2372AlogP: 3.33#Rotatable Bonds: 5
Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.48CX Basic pKa: 6.78CX LogP: 3.12CX LogD: 3.03
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -1.97

References

1. Gu SJ, Lee JK, Pae AN, Chung HJ, Rhim H, Han SY, Min SJ, Cho YS..  (2010)  Synthesis and biological evaluation of 1,4-diazepane derivatives as T-type calcium channel blockers.,  20  (9): [PMID:20382529] [10.1016/j.bmcl.2010.03.084]

Source