methyl 4-(6-{4-[(anilinocarbonyl)amino]phenyl}-4-morpholin-4-yl-1H-pyrazolo[3,4-d]pyrimidin-1-yl)piperidine-1-carboxylate

ID: ALA1098244

PubChem CID: 44605038

Max Phase: Preclinical

Molecular Formula: C29H32N8O4

Molecular Weight: 556.63

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)N1CCC(n2ncc3c(N4CCOCC4)nc(-c4ccc(NC(=O)Nc5ccccc5)cc4)nc32)CC1

Standard InChI:  InChI=1S/C29H32N8O4/c1-40-29(39)36-13-11-23(12-14-36)37-27-24(19-30-37)26(35-15-17-41-18-16-35)33-25(34-27)20-7-9-22(10-8-20)32-28(38)31-21-5-3-2-4-6-21/h2-10,19,23H,11-18H2,1H3,(H2,31,32,38)

Standard InChI Key:  FIUDAJSOKHKCEH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
   15.5583  -17.9994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5571  -18.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2726  -19.2407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2708  -17.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9868  -17.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9917  -18.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7843  -19.0799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2693  -18.4041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7764  -17.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8437  -19.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1285  -18.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1323  -20.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8444  -20.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2683  -16.7605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9802  -16.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9797  -15.5264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2651  -15.1118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5495  -15.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5483  -16.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1912  -19.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7746  -20.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1808  -21.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0025  -21.2176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4160  -20.5038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0074  -19.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4125  -20.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4107  -19.2384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4128  -21.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6983  -20.4777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9823  -20.0664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9804  -19.2407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2682  -20.4809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5520  -20.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9976  -22.6478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2386  -21.9370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6490  -22.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5539  -19.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8387  -18.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1235  -19.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1282  -20.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8439  -20.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
 18 19  1  0
  9  5  1  0
  7 20  1  0
  4  1  1  0
 20 21  1  0
  5  6  1  0
 21 22  1  0
 10 11  2  0
 22 23  1  0
 11 27  1  0
 23 24  1  0
 24 25  1  0
 25 20  1  0
 26 27  2  0
 26 12  1  0
  2  3  1  0
 12 13  2  0
 23 28  1  0
 13 10  1  0
 26 29  1  0
  2 10  1  0
 29 30  1  0
  3  6  2  0
 30 31  2  0
  4 14  1  0
 30 32  1  0
 14 15  1  0
 32 33  1  0
  1  2  2  0
 28 34  2  0
  5  4  2  0
 28 35  1  0
  6  7  1  0
 35 36  1  0
  7  8  1  0
 33 37  2  0
  8  9  2  0
 37 38  1  0
 14 19  1  0
 38 39  2  0
 15 16  1  0
 39 40  1  0
 16 17  1  0
 40 41  2  0
 41 33  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1098244

   methyl 4-(6-{4-[(anilinocarbonyl)amino]phenyl}-4-morpholin-4-yl-1H-pyrazolo[3,4-d]pyrimidin-1-yl)piperidine-1-carboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 556.63

Molecular Weight (Monoisotopic): 556.2547

AlogP: 4.38

#Rotatable Bonds: 5

Polar Surface Area: 126.74

Molecular Species: NEUTRAL

HBA: 9

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 12

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 11.32

CX Basic pKa: 4.01

CX LogP: 4.02

CX LogD: 4.02

Aromatic Rings: 4

Heavy Atoms: 41

QED Weighted: 0.37

Np Likeness Score: -1.82

References

1. Verheijen JC, Richard DJ, Curran K, Kaplan J, Lefever M, Nowak P, Malwitz DJ, Brooijmans N, Toral-Barza L, Zhang WG, Lucas J, Hollander I, Ayral-Kaloustian S, Mansour TS, Yu K, Zask A..  (2009)  Discovery of 4-morpholino-6-aryl-1H-pyrazolo[3,4-d]pyrimidines as highly potent and selective ATP-competitive inhibitors of the mammalian target of rapamycin (mTOR): optimization of the 6-aryl substituent.,  52  (24): [PMID:19894727] [10.1021/jm9013828]

Source

Source(1):

• Scientific Literature