The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(2,4-dichloro-5-methoxyphenylamino)-6-methoxy-7-(11-morpholinoundec-1-enyl)quinoline-3-carbonitrile ID: ALA1098363
PubChem CID: 46889032
Max Phase: Preclinical
Molecular Formula: C33H40Cl2N4O3
Molecular Weight: 611.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2c(C#N)cnc3cc(/C=C/CCCCCCCCCN4CCOCC4)c(OC)cc23)c(Cl)cc1Cl
Standard InChI: InChI=1S/C33H40Cl2N4O3/c1-40-31-19-26-29(37-23-25(22-36)33(26)38-30-21-32(41-2)28(35)20-27(30)34)18-24(31)12-10-8-6-4-3-5-7-9-11-13-39-14-16-42-17-15-39/h10,12,18-21,23H,3-9,11,13-17H2,1-2H3,(H,37,38)/b12-10+
Standard InChI Key: PYCPJIWELLKLKR-ZRDIBKRKSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
11.7808 -17.4544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7709 -16.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0556 -16.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3449 -16.6485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3524 -17.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0706 -17.8787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9074 -16.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6168 -15.6276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9226 -17.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6416 -17.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3511 -17.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0815 -17.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0436 -16.1058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3392 -16.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6203 -16.1326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9051 -16.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7726 -16.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7888 -17.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5066 -17.7240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2086 -17.3019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1957 -16.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4664 -16.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1731 -14.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8894 -15.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6049 -14.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5954 -13.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8727 -13.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1613 -14.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4422 -13.6117 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
25.3239 -15.2302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0316 -14.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3091 -13.5762 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.2158 -17.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4962 -17.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7869 -17.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0673 -17.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3581 -17.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6385 -17.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9293 -17.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2097 -17.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5004 -17.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4609 -15.2541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
11 12 2 0
12 18 1 0
17 13 1 0
13 14 2 0
14 11 1 0
14 15 1 0
15 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 2 0
21 7 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
25 30 1 0
30 31 1 0
26 32 1 0
9 33 1 0
5 6 1 0
33 34 1 0
34 35 1 0
1 2 1 0
35 36 1 0
1 6 1 0
36 37 1 0
2 3 1 0
37 38 1 0
3 4 1 0
38 39 1 0
4 5 1 0
39 40 1 0
7 8 3 0
40 41 1 0
41 1 1 0
9 10 2 0
22 42 1 0
42 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 611.61Molecular Weight (Monoisotopic): 610.2477AlogP: 8.64#Rotatable Bonds: 15Polar Surface Area: 79.64Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.77CX LogP: 8.05CX LogD: 7.53Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: -0.84
References 1. Boschelli DH, Wang D, Wang Y, Wu B, Honores EE, Barrios Sosa AC, Chaudhary I, Golas J, Lucas J, Boschelli F.. (2010) Optimization of 7-alkene-3-quinolinecarbonitriles as Src kinase inhibitors., 20 (9): [PMID:20363128 ] [10.1016/j.bmcl.2010.03.025 ]