The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((1,3,6,7-Tetramethoxyxanthone-4-yl)-sulfonyl)-3-carbethoxy-piperidine ID: ALA1098394
PubChem CID: 46887486
Max Phase: Preclinical
Molecular Formula: C25H29NO10S
Molecular Weight: 535.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1CCCN(S(=O)(=O)c2c(OC)cc(OC)c3c(=O)c4cc(OC)c(OC)cc4oc23)C1
Standard InChI: InChI=1S/C25H29NO10S/c1-6-35-25(28)14-8-7-9-26(13-14)37(29,30)24-20(34-5)12-19(33-4)21-22(27)15-10-17(31-2)18(32-3)11-16(15)36-23(21)24/h10-12,14H,6-9,13H2,1-5H3
Standard InChI Key: REOIEVJDEBIRCI-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-2.6180 -5.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0435 -5.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8738 -5.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2707 -5.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7931 -5.8512 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.6443 -4.4338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8195 -4.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0955 -5.9116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5223 -5.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0186 -6.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8461 -6.5998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2464 -7.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5914 -7.2930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0713 -7.3307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9962 -8.0168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8213 -8.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2243 -8.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8032 -9.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9750 -9.4401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5757 -8.7216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2058 -10.1733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0307 -10.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5510 -10.1479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9520 -10.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3686 -6.5586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3875 -5.1333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2125 -5.1333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7692 -7.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3483 -7.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5230 -7.9763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1204 -7.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5430 -6.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7045 -7.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1266 -7.9530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1074 -6.5241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7237 -8.6729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1457 -9.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 2 0
3 4 2 0
18 19 1 0
8 9 1 0
19 20 2 0
20 15 1 0
10 11 2 0
18 21 1 0
4 11 1 0
21 22 1 0
1 2 2 0
19 23 1 0
1 5 1 0
23 24 1 0
10 1 1 0
5 25 1 0
10 13 1 0
5 26 2 0
11 12 1 0
5 27 2 0
25 28 1 0
12 16 1 0
15 13 1 0
2 6 1 0
12 14 2 0
2 3 1 0
25 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
6 7 1 0
31 33 1 0
15 16 2 0
33 34 1 0
33 35 2 0
16 17 1 0
34 36 1 0
4 8 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.57Molecular Weight (Monoisotopic): 535.1512AlogP: 2.94#Rotatable Bonds: 8Polar Surface Area: 130.81Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.11CX LogD: 2.11Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -0.28
References 1. Hu H, Liao H, Zhang J, Wu W, Yan J, Yan Y, Zhao Q, Zou Y, Chai X, Yu S, Wu Q.. (2010) First identification of xanthone sulfonamides as potent acyl-CoA:cholesterol acyltransferase (ACAT) inhibitors., 20 (10): [PMID:20403694 ] [10.1016/j.bmcl.2010.03.101 ]