5-(3-chloro-4-fluorophenyl)-3-stearoylpyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione

ID: ALA1098533

PubChem CID: 46888285

Max Phase: Preclinical

Molecular Formula: C29H39ClFN3O3

Molecular Weight: 532.10

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCCCC(=O)c1n[nH]c2c1C(=O)N(c1ccc(F)c(Cl)c1)C2=O

Standard InChI:  InChI=1S/C29H39ClFN3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(35)26-25-27(33-32-26)29(37)34(28(25)36)21-18-19-23(31)22(30)20-21/h18-20H,2-17H2,1H3,(H,32,33)

Standard InChI Key:  JODYQHMJRBYTPQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   -1.5038  -25.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5112  -24.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9932  -25.0229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7249  -24.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7259  -25.4243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0645  -25.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5423  -25.0043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3309  -26.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2549  -27.0437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7740  -23.5701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7521  -26.4678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8157  -25.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2259  -24.3123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0600  -24.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4777  -25.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0609  -25.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2260  -25.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0443  -26.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7582  -26.4521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4722  -26.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1862  -26.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9002  -26.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6142  -26.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3281  -26.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0421  -26.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7561  -26.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4701  -26.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1840  -26.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8980  -26.4313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6120  -26.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3260  -26.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0399  -26.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7539  -26.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4679  -26.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4753  -26.4724    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.3000  -25.0320    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0566  -24.3374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 17 12  1  0
  8 18  1  0
  1  5  1  0
 18 19  1  0
  4  2  1  0
 19 20  1  0
  2  3  1  0
 20 21  1  0
  3  1  1  0
 21 22  1  0
  4  5  2  0
 22 23  1  0
  5  6  1  0
 23 24  1  0
  6  7  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  6  8  1  0
 27 28  1  0
  8  9  2  0
 28 29  1  0
  2 10  2  0
 29 30  1  0
  1 11  2  0
 30 31  1  0
  3 12  1  0
 31 32  1  0
 12 13  2  0
 32 33  1  0
 13 14  1  0
 33 34  1  0
 14 15  2  0
 16 35  1  0
 15 16  1  0
 15 36  1  0
 16 17  2  0
  7 37  1  0
 37  4  1  0
M  END

Associated Targets(Human)

CDC25B Tchem Dual specificity phosphatase Cdc25B (1099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.10Molecular Weight (Monoisotopic): 531.2664AlogP: 8.45#Rotatable Bonds: 18
Polar Surface Area: 83.13Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 5.13CX Basic pKa: CX LogP: 8.86CX LogD: 7.33
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.12Np Likeness Score: -0.94

References

1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ..  (2010)  Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B.,  20  (9): [PMID:20363629] [10.1016/j.bmcl.2010.03.040]

Source