2-[4-(1H-benzoimidazole-2-carbonyl)-phenyl]-3a,4,9,9a-tetrahydro-4,9-benzeno-benz-[f]isoindole-1,3-dione

ID: ALA1098578

PubChem CID: 46193398

Max Phase: Preclinical

Molecular Formula: C32H21N3O3

Molecular Weight: 495.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1)c1nc2ccccc2[nH]1

Standard InChI:  InChI=1S/C32H21N3O3/c36-29(30-33-23-11-5-6-12-24(23)34-30)17-13-15-18(16-14-17)35-31(37)27-25-19-7-1-2-8-20(19)26(28(27)32(35)38)22-10-4-3-9-21(22)25/h1-16,25-28H,(H,33,34)

Standard InChI Key:  DSCJLQRSDHTCBX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 45  0  0  0  0  0  0  0  0999 V2000
   -6.3085   -8.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6194   -7.6480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8463   -6.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9123   -8.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9238   -8.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2175   -9.2993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5022   -8.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4974   -8.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2042   -7.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7946   -9.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8009  -10.1317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3424   -6.2086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3373   -8.9257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9429   -7.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6614   -6.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3183   -6.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7777   -7.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4803   -6.0929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7871   -5.6301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8387   -4.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5926   -4.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2770   -4.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2205   -5.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5821   -7.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8102   -7.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6126   -6.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1945   -7.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9629   -8.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1599   -8.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0804   -8.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3018   -9.1612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0858   -8.0906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3057   -7.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8228   -8.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0076   -8.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3258   -7.6598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1622   -6.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9757   -7.0849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
 14  1  1  0
 18 19  2  0
  8  9  2  0
 19 20  1  0
  9  4  1  0
 20 21  2  0
  2  4  1  0
 21 22  1  0
  7 10  1  0
 22 23  2  0
 23 18  1  0
 10 11  2  0
 24 25  2  0
  4  5  2  0
 25 26  1  0
  3 12  2  0
 26 27  2  0
  1  2  1  0
 27 28  1  0
  1 13  2  0
 28 29  2  0
 29 24  1  0
 16 25  1  0
 18 17  1  0
 14 15  1  0
 10 30  1  0
 31 34  1  0
  5  6  1  0
  2  3  1  0
 30 31  2  0
 33 32  1  0
 32 30  1  0
 15 16  1  0
 17 14  1  0
 33 34  2  0
  6  7  2  0
 34 35  1  0
 16 19  1  0
 35 36  2  0
  3 15  1  0
 36 37  1  0
 24 17  1  0
 37 38  2  0
 38 33  1  0
M  END

Associated Targets(non-human)

Bacillus thuringiensis (718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 495.54Molecular Weight (Monoisotopic): 495.1583AlogP: 5.19#Rotatable Bonds: 3
Polar Surface Area: 83.13Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.98CX Basic pKa: 3.12CX LogP: 5.15CX LogD: 5.14
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -0.65

References

1. Khalil AM, Berghot MA, Gouda MA..  (2010)  Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents.,  45  (4): [PMID:20117862] [10.1016/j.ejmech.2009.12.064]

Source