The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-[1-acetyl-1H-benzimidazol-2-yl]-9,10-dihydro-9,10-ethanoanthracene-11-carboxylic acid ID: ALA1098579
PubChem CID: 46886845
Max Phase: Preclinical
Molecular Formula: C26H20N2O4
Molecular Weight: 424.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)n1c(C2C3c4ccccc4C(c4ccccc43)C2C(=O)O)nc2ccccc21
Standard InChI: InChI=1S/C26H20N2O4/c1-32-26(31)28-19-13-7-6-12-18(19)27-24(28)22-20-14-8-2-4-10-16(14)21(23(22)25(29)30)17-11-5-3-9-15(17)20/h2-13,20-23H,1H3,(H,29,30)
Standard InChI Key: IFLNBOXJWJFGFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
6.8148 -7.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8205 -8.5400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5823 -7.4620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0725 -8.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5982 -8.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9377 -9.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7513 -9.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2242 -8.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8820 -8.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1488 -7.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1439 -6.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3595 -6.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3632 -7.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1994 -6.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6863 -5.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3499 -4.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5270 -4.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0416 -5.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3806 -6.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6915 -8.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2041 -7.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3825 -7.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0471 -8.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5396 -8.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3595 -8.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8510 -6.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5597 -6.4195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8477 -5.1977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4047 -9.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5884 -9.2340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -9.9541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1725 -9.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14 15 2 0
3 1 2 0
15 16 1 0
7 8 1 0
16 17 2 0
17 18 1 0
8 9 2 0
18 19 2 0
19 14 1 0
9 4 1 0
2 5 1 0
20 21 2 0
1 10 1 0
21 22 1 0
10 11 1 0
22 23 2 0
4 5 2 0
23 24 1 0
11 12 1 0
24 25 2 0
25 20 1 0
12 21 1 0
14 13 1 0
13 10 1 0
1 2 1 0
12 15 1 0
26 27 1 0
26 28 2 0
11 26 1 0
5 6 1 0
2 29 1 0
20 13 1 0
29 30 1 0
4 3 1 0
29 31 2 0
6 7 2 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.46Molecular Weight (Monoisotopic): 424.1423AlogP: 4.73#Rotatable Bonds: 2Polar Surface Area: 81.42Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.10CX Basic pKa: 2.03CX LogP: 4.28CX LogD: 1.18Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -0.28
References 1. Khalil AM, Berghot MA, Gouda MA.. (2010) Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents., 45 (4): [PMID:20117862 ] [10.1016/j.ejmech.2009.12.064 ]