1-(2-cyclohexylethyl)-6-methyl-3-(3-(trifluoromethoxy)phenyl)pyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione

ID: ALA1098624

PubChem CID: 46886667

Max Phase: Preclinical

Molecular Formula: C21H22F3N5O3

Molecular Weight: 449.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1c(=O)nc2n(CCC3CCCCC3)nc(-c3cccc(OC(F)(F)F)c3)nc-2c1=O

Standard InChI:  InChI=1S/C21H22F3N5O3/c1-28-19(30)16-18(26-20(28)31)29(11-10-13-6-3-2-4-7-13)27-17(25-16)14-8-5-9-15(12-14)32-21(22,23)24/h5,8-9,12-13H,2-4,6-7,10-11H2,1H3

Standard InChI Key:  ZXFZKIMZCQLPOW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -1.6264   -0.9375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6276   -1.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9146   -0.5247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1992   -0.9338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1984   -1.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5169   -2.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2319   -1.7569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2271   -0.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5112   -0.5197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9391   -0.5101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5186   -2.9966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9170    0.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3424   -2.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9480   -2.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0549   -1.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7692   -2.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7703   -2.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0511   -3.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3398   -2.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2038    0.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2101    1.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5054    1.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5011    2.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2140    3.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9266    2.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9239    1.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4832   -1.7601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4821   -0.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1960   -0.5217    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7671   -0.5235    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4875   -0.1083    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9128   -2.1777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
 13 15  2  0
  6  7  1  0
 15 16  1  0
  4  3  1  0
 16 17  2  0
  7  8  1  0
 17 18  1  0
  3  1  1  0
 18 19  2  0
 19 13  1  0
  8  9  1  0
 12 20  1  0
  9  4  2  0
 20 21  1  0
 21 22  1  0
  8 10  2  0
  2 32  1  0
  6 11  2  0
  4  5  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
  3 12  1  0
 16 27  1  0
 32  5  2  0
 27 28  1  0
  2 13  1  0
 28 29  1  0
  5  6  1  0
 28 30  1  0
  7 14  1  0
 28 31  1  0
M  END

Associated Targets(Human)

SK-N-SH (1499 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.43Molecular Weight (Monoisotopic): 449.1675AlogP: 3.37#Rotatable Bonds: 5
Polar Surface Area: 91.90Molecular Species: HBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.70CX LogD: 4.70
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -1.08

References

1. Zhou Y, Liu G, Chen J, Reddy PS, Yoon IS, Zhang M, Zhang B, Barber JR, Ng SC..  (2009)  Pyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione derivatives: their cytoprotection effect from rotenone toxicity and preliminary DMPK properties.,  19  (21): [PMID:19786349] [10.1016/j.bmcl.2009.09.021]

Source