The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[(S)-2-((S)-2-Acetylamino-3-hydroxy-propionylamino)-4-methyl-pentanoylamino]-3-methyl-butyric acid methyl ester ID: ALA109876
PubChem CID: 44340708
Max Phase: Preclinical
Molecular Formula: C17H31N3O6
Molecular Weight: 373.45
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(C)=O)C(C)C
Standard InChI: InChI=1S/C17H31N3O6/c1-9(2)7-12(19-16(24)13(8-21)18-11(5)22)15(23)20-14(10(3)4)17(25)26-6/h9-10,12-14,21H,7-8H2,1-6H3,(H,18,22)(H,19,24)(H,20,23)/t12-,13-,14-/m0/s1
Standard InChI Key: BRIGIKGUSAHAGE-IHRRRGAJSA-N
Molfile:
RDKit 2D
26 25 0 0 1 0 0 0 0 0999 V2000
7.1542 -4.3417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3000 -4.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4417 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0125 -3.9292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5792 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8667 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7292 -4.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8667 -4.3417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5875 -4.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1542 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3000 -5.1750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4417 -3.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5875 -5.1750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7292 -5.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1542 -3.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8667 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3000 -3.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5792 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2917 -2.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1375 -5.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4417 -4.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1542 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5792 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3000 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7167 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9625 -5.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 7 1 0
5 2 1 0
6 1 1 0
7 3 1 0
8 5 1 0
9 6 1 0
10 8 1 0
11 2 2 0
12 3 2 0
13 9 2 0
7 14 1 6
15 10 2 0
6 16 1 1
17 9 1 0
5 18 1 1
19 18 1 0
20 14 1 0
21 10 1 0
22 16 1 0
23 16 1 0
24 17 1 0
25 20 1 0
26 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 373.45Molecular Weight (Monoisotopic): 373.2213AlogP: -0.67#Rotatable Bonds: 10Polar Surface Area: 133.83Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.87CX Basic pKa: ┄CX LogP: -0.59CX LogD: -0.59Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.38Np Likeness Score: 0.22
References 1. Sawa E, Takahashi M, Kamishohara M, Tazunoki T, Kimura K, Arai M, Miyazaki T, Kataoka S, Nishitoba T.. (1999) Structural modification of Fas C-terminal tripeptide and its effects on the inhibitory activity of Fas/FAP-1 binding., 42 (17): [PMID:10464015 ] [10.1021/jm980617f ] 2. He, Yantao Y and 11 more authors. 2013-06-27 A potent and selective small-molecule inhibitor for the lymphoid-specific tyrosine phosphatase (LYP), a target associated with autoimmune diseases. [PMID:23713581 ]