5-benzyl-3-stearoylpyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione

ID: ALA1098806

PubChem CID: 46888286

Max Phase: Preclinical

Molecular Formula: C30H43N3O3

Molecular Weight: 493.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCCCC(=O)c1n[nH]c2c1C(=O)N(Cc1ccccc1)C2=O

Standard InChI:  InChI=1S/C30H43N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-25(34)27-26-28(32-31-27)30(36)33(29(26)35)23-24-20-17-16-18-21-24/h16-18,20-21H,2-15,19,22-23H2,1H3,(H,31,32)

Standard InChI Key:  KJYHBJPRBRMHPE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   -2.4347    0.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4422    1.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9243    0.9809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6559    1.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6569    0.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8665    0.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3886    0.9995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6002   -0.4555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1860   -1.0399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7049    2.4337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6832   -0.4640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1133   -0.8616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8273   -0.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5413   -0.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2553   -0.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9692   -0.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6832   -0.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3972   -0.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1112   -0.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8251   -0.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5391   -0.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2531   -0.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9671   -0.4274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6810   -0.8366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3950   -0.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1090   -0.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8230   -0.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5370   -0.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7509    0.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1703    1.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7653    2.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1841    3.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0116    3.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4186    2.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9974    1.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8744    1.6663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  5  6  1  0
 17 18  1  0
  6  7  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  6  8  1  0
 21 22  1  0
  8  9  2  0
 22 23  1  0
  2 10  2  0
 23 24  1  0
  1 11  2  0
 24 25  1  0
 25 26  1  0
  8 12  1  0
 26 27  1  0
  1  5  1  0
 27 28  1  0
 12 13  1  0
  3 29  1  0
  4  2  1  0
 29 30  1  0
 13 14  1  0
 30 31  2  0
  2  3  1  0
 31 32  1  0
 14 15  1  0
 32 33  2  0
  3  1  1  0
 33 34  1  0
 15 16  1  0
 34 35  2  0
 35 30  1  0
  4  5  2  0
  7 36  1  0
 36  4  1  0
M  END

Associated Targets(Human)

CDC25B Tchem Dual specificity phosphatase Cdc25B (1099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.69Molecular Weight (Monoisotopic): 493.3304AlogP: 7.65#Rotatable Bonds: 19
Polar Surface Area: 83.13Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.53CX Basic pKa: CX LogP: 8.18CX LogD: 8.15
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: -0.48

References

1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ..  (2010)  Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B.,  20  (9): [PMID:20363629] [10.1016/j.bmcl.2010.03.040]

Source