5-(4-fluorobenzyl)-3-stearoylpyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione

ID: ALA1098807

PubChem CID: 46888287

Max Phase: Preclinical

Molecular Formula: C30H42FN3O3

Molecular Weight: 511.68

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCCCC(=O)c1n[nH]c2c1C(=O)N(Cc1ccc(F)cc1)C2=O

Standard InChI:  InChI=1S/C30H42FN3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25(35)27-26-28(33-32-27)30(37)34(29(26)36)22-23-18-20-24(31)21-19-23/h18-21H,2-17,22H2,1H3,(H,32,33)

Standard InChI Key:  WMMNBMRPXBOXDC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   -2.2469   -4.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2543   -3.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7364   -4.1547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4680   -3.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4690   -4.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6786   -4.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2007   -4.1361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4123   -5.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9981   -6.1755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5170   -2.7019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4953   -5.5996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3012   -5.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0152   -5.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7292   -5.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4431   -5.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1571   -5.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8711   -5.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5851   -5.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2990   -5.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0130   -5.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7270   -5.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4410   -5.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1550   -5.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8689   -5.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5829   -5.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2969   -5.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0109   -5.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7248   -5.9639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5630   -4.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9824   -3.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5774   -2.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9962   -2.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8237   -2.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2307   -2.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8096   -3.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2442   -1.3141    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6865   -3.4693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
 17 18  1  0
  6  7  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  6  8  1  0
 21 22  1  0
  8  9  2  0
 22 23  1  0
  2 10  2  0
 23 24  1  0
  1 11  2  0
 24 25  1  0
 25 26  1  0
  8 12  1  0
 26 27  1  0
  1  5  1  0
 27 28  1  0
 12 13  1  0
  3 29  1  0
  4  2  1  0
 29 30  1  0
 13 14  1  0
 30 31  2  0
  2  3  1  0
 31 32  1  0
 14 15  1  0
 32 33  2  0
  3  1  1  0
 33 34  1  0
 15 16  1  0
 34 35  2  0
 35 30  1  0
  4  5  2  0
 33 36  1  0
 16 17  1  0
  7 37  1  0
 37  4  1  0
M  END

Associated Targets(Human)

CDC25B Tchem Dual specificity phosphatase Cdc25B (1099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.68Molecular Weight (Monoisotopic): 511.3210AlogP: 7.79#Rotatable Bonds: 19
Polar Surface Area: 83.13Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.53CX Basic pKa: CX LogP: 8.32CX LogD: 8.29
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.12Np Likeness Score: -0.67

References

1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ..  (2010)  Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B.,  20  (9): [PMID:20363629] [10.1016/j.bmcl.2010.03.040]

Source