The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-fluorobenzyl)-3-stearoylpyrrolo[3,4-c]pyrazole-4,6(1H,5H)-dione ID: ALA1098807
PubChem CID: 46888287
Max Phase: Preclinical
Molecular Formula: C30H42FN3O3
Molecular Weight: 511.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCCC(=O)c1n[nH]c2c1C(=O)N(Cc1ccc(F)cc1)C2=O
Standard InChI: InChI=1S/C30H42FN3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25(35)27-26-28(33-32-27)30(37)34(29(26)36)22-23-18-20-24(31)21-19-23/h18-21H,2-17,22H2,1H3,(H,32,33)
Standard InChI Key: WMMNBMRPXBOXDC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
-2.2469 -4.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2543 -3.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7364 -4.1547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4680 -3.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4690 -4.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6786 -4.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2007 -4.1361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4123 -5.5911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9981 -6.1755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5170 -2.7019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4953 -5.5996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3012 -5.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0152 -5.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7292 -5.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4431 -5.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1571 -5.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8711 -5.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5851 -5.9847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2990 -5.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0130 -5.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7270 -5.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4410 -5.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1550 -5.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8689 -5.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5829 -5.5588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2969 -5.9681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0109 -5.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7248 -5.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5630 -4.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9824 -3.4494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5774 -2.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9962 -2.0193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8237 -2.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2307 -2.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8096 -3.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2442 -1.3141 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.6865 -3.4693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
17 18 1 0
6 7 2 0
18 19 1 0
19 20 1 0
20 21 1 0
6 8 1 0
21 22 1 0
8 9 2 0
22 23 1 0
2 10 2 0
23 24 1 0
1 11 2 0
24 25 1 0
25 26 1 0
8 12 1 0
26 27 1 0
1 5 1 0
27 28 1 0
12 13 1 0
3 29 1 0
4 2 1 0
29 30 1 0
13 14 1 0
30 31 2 0
2 3 1 0
31 32 1 0
14 15 1 0
32 33 2 0
3 1 1 0
33 34 1 0
15 16 1 0
34 35 2 0
35 30 1 0
4 5 2 0
33 36 1 0
16 17 1 0
7 37 1 0
37 4 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.68Molecular Weight (Monoisotopic): 511.3210AlogP: 7.79#Rotatable Bonds: 19Polar Surface Area: 83.13Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.53CX Basic pKa: ┄CX LogP: 8.32CX LogD: 8.29Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.12Np Likeness Score: -0.67
References 1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ.. (2010) Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B., 20 (9): [PMID:20363629 ] [10.1016/j.bmcl.2010.03.040 ]