methyl 3-(4,6-dioxo-3-stearoylpyrrolo[3,4-c]pyrazol-5(1H,4H,6H)-yl)thiophene-2-carboxylate

ID: ALA1098821

PubChem CID: 46888288

Max Phase: Preclinical

Molecular Formula: C29H41N3O5S

Molecular Weight: 543.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCCCC(=O)c1n[nH]c2c1C(=O)N(c1ccsc1C(=O)OC)C2=O

Standard InChI:  InChI=1S/C29H41N3O5S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(33)24-23-25(31-30-24)28(35)32(27(23)34)21-19-20-38-26(21)29(36)37-2/h19-20H,3-18H2,1-2H3,(H,30,31)

Standard InChI Key:  STALDSQAXVUPQX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   -5.0128   -5.7786    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4273   -6.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6848   -5.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8254   -5.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6380   -5.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0139   -4.3091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5660   -3.6164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8389   -4.3091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9419   -2.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4315   -4.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3800   -3.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2420   -4.5832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6453   -3.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0642   -3.9683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3296   -3.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4643   -2.7742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5913   -3.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5913   -4.7781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1170   -3.3927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0508   -5.4332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1232   -3.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1232   -2.7156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8376   -2.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8376   -1.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5521   -1.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5521   -0.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2666    0.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2666    0.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9811    1.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9811    2.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6955    2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6955    3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4100    3.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4100    4.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1245    5.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1245    5.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8389    6.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2793   -2.6465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 15 17  1  0
 17 18  2  0
 11 19  2  0
 10 20  2  0
  5  1  1  0
 17 21  1  0
 21 22  1  0
  5  6  1  0
 22 23  1  0
  1  2  1  0
 23 24  1  0
  6  7  1  0
 24 25  1  0
  2  3  2  0
 25 26  1  0
  6  8  2  0
 26 27  1  0
  3  4  1  0
 27 28  1  0
  7  9  1  0
 28 29  1  0
  4  5  2  0
 29 30  1  0
 10 14  1  0
 30 31  1  0
 13 11  1  0
 31 32  1  0
 11 12  1  0
 32 33  1  0
 12 10  1  0
 33 34  1  0
 13 14  2  0
 34 35  1  0
 14 15  1  0
 35 36  1  0
 15 16  2  0
 36 37  1  0
 12  4  1  0
 38 13  1  0
 16 38  1  0
M  END

Associated Targets(Human)

CDC25B Tchem Dual specificity phosphatase Cdc25B (1099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.73Molecular Weight (Monoisotopic): 543.2767AlogP: 7.50#Rotatable Bonds: 19
Polar Surface Area: 109.43Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 5.13CX Basic pKa: CX LogP: 8.03CX LogD: 6.50
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.08Np Likeness Score: -0.64

References

1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ..  (2010)  Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B.,  20  (9): [PMID:20363629] [10.1016/j.bmcl.2010.03.040]

Source