The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 3-(4,6-dioxo-3-stearoylpyrrolo[3,4-c]pyrazol-5(1H,4H,6H)-yl)thiophene-2-carboxylate ID: ALA1098821
PubChem CID: 46888288
Max Phase: Preclinical
Molecular Formula: C29H41N3O5S
Molecular Weight: 543.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCCC(=O)c1n[nH]c2c1C(=O)N(c1ccsc1C(=O)OC)C2=O
Standard InChI: InChI=1S/C29H41N3O5S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(33)24-23-25(31-30-24)28(35)32(27(23)34)21-19-20-38-26(21)29(36)37-2/h19-20H,3-18H2,1-2H3,(H,30,31)
Standard InChI Key: STALDSQAXVUPQX-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
-5.0128 -5.7786 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.4273 -6.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6848 -5.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8254 -5.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6380 -5.0435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0139 -4.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5660 -3.6164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.8389 -4.3091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9419 -2.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4315 -4.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3800 -3.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2420 -4.5832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6453 -3.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0642 -3.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3296 -3.5849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4643 -2.7742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5913 -3.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5913 -4.7781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1170 -3.3927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0508 -5.4332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1232 -3.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1232 -2.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8376 -2.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8376 -1.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5521 -1.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5521 -0.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2666 0.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2666 0.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9811 1.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9811 2.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6955 2.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6955 3.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4100 3.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4100 4.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1245 5.1219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1245 5.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8389 6.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2793 -2.6465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15 17 1 0
17 18 2 0
11 19 2 0
10 20 2 0
5 1 1 0
17 21 1 0
21 22 1 0
5 6 1 0
22 23 1 0
1 2 1 0
23 24 1 0
6 7 1 0
24 25 1 0
2 3 2 0
25 26 1 0
6 8 2 0
26 27 1 0
3 4 1 0
27 28 1 0
7 9 1 0
28 29 1 0
4 5 2 0
29 30 1 0
10 14 1 0
30 31 1 0
13 11 1 0
31 32 1 0
11 12 1 0
32 33 1 0
12 10 1 0
33 34 1 0
13 14 2 0
34 35 1 0
14 15 1 0
35 36 1 0
15 16 2 0
36 37 1 0
12 4 1 0
38 13 1 0
16 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.73Molecular Weight (Monoisotopic): 543.2767AlogP: 7.50#Rotatable Bonds: 19Polar Surface Area: 109.43Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 5.13CX Basic pKa: ┄CX LogP: 8.03CX LogD: 6.50Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.08Np Likeness Score: -0.64
References 1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ.. (2010) Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B., 20 (9): [PMID:20363629 ] [10.1016/j.bmcl.2010.03.040 ]