The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3'-(ethylsulfonyl)biphenyl-3-yl)-3-methyl-8-(trifluoromethyl)quinoline ID: ALA1098832
PubChem CID: 46887853
Max Phase: Preclinical
Molecular Formula: C25H20F3NO2S
Molecular Weight: 455.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)c1cccc(-c2cccc(-c3c(C)cnc4c(C(F)(F)F)cccc34)c2)c1
Standard InChI: InChI=1S/C25H20F3NO2S/c1-3-32(30,31)20-10-5-8-18(14-20)17-7-4-9-19(13-17)23-16(2)15-29-24-21(23)11-6-12-22(24)25(26,27)28/h4-15H,3H2,1-2H3
Standard InChI Key: JVIDKHNOLQEIJP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
14.1152 -23.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1141 -24.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8289 -24.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8271 -22.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5425 -23.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5432 -24.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2585 -24.4258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9736 -24.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9688 -23.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2529 -22.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2480 -21.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9619 -21.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9579 -20.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2407 -20.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5261 -20.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5336 -21.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6715 -20.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3882 -20.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1002 -20.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0967 -19.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3752 -19.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6662 -19.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8308 -25.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1173 -25.6710 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5462 -25.6677 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.8250 -26.0792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.3683 -18.2393 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.0793 -17.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5667 -18.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9500 -17.5208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7957 -18.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6807 -22.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 2 0
16 11 1 0
10 11 1 0
7 8 2 0
5 4 2 0
17 18 2 0
8 9 1 0
18 19 1 0
4 1 1 0
19 20 2 0
9 10 2 0
20 21 1 0
10 5 1 0
21 22 2 0
22 17 1 0
13 17 1 0
3 23 1 0
2 3 1 0
23 24 1 0
11 12 2 0
23 25 1 0
5 6 1 0
23 26 1 0
12 13 1 0
21 27 1 0
3 6 2 0
27 28 1 0
13 14 2 0
27 29 2 0
6 7 1 0
27 30 2 0
14 15 1 0
28 31 1 0
1 2 2 0
9 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.50Molecular Weight (Monoisotopic): 455.1167AlogP: 6.69#Rotatable Bonds: 4Polar Surface Area: 47.03Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.57CX LogP: 6.17CX LogD: 6.17Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -1.15
References 1. Ullrich JW, Morris R, Bernotas RC, Travins JM, Jetter J, Unwalla R, Quinet E, Nambi P, Feingold I, Huselton C, Enroth C, Wilhelmsson A, Goos-Nilsson A, Wrobel J.. (2010) Synthesis of 4-(3-biaryl)quinoline sulfones as potent liver X receptor agonists., 20 (9): [PMID:20382019 ] [10.1016/j.bmcl.2010.03.031 ]