N,6-dibenzyl-1-cyclopentyl-1H-benzo[d]imidazol-4-amine

ID: ALA1098842

PubChem CID: 46888164

Max Phase: Preclinical

Molecular Formula: C26H27N3

Molecular Weight: 381.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1ccc(CNc2cc(Cc3ccccc3)cc3c2ncn3C2CCCC2)cc1

Standard InChI:  InChI=1S/C26H27N3/c1-3-9-20(10-4-1)15-22-16-24(27-18-21-11-5-2-6-12-21)26-25(17-22)29(19-28-26)23-13-7-8-14-23/h1-6,9-12,16-17,19,23,27H,7-8,13-15,18H2

Standard InChI Key:  ZPTQTUVZLIPSMG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   -5.0112  -10.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0125  -11.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2988  -12.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5789  -11.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5821  -10.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3008  -10.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8689  -10.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1517  -10.8155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1476  -11.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8607  -12.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8569  -12.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1393  -13.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4311  -12.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4271  -12.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6453  -13.1164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1661  -12.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6518  -11.7886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2386  -13.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5703  -13.2962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5665  -14.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2822  -14.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2789  -15.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5614  -15.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8457  -15.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8526  -14.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5059  -14.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1446  -15.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8184  -14.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5842  -13.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  5  7  1  0
  3  4  2  0
  7  8  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
 15 18  1  0
  8  9  1  0
 11 19  1  0
  4  5  1  0
 19 20  1  0
  9 10  2  0
 20 21  2  0
  2  3  1  0
 21 22  1  0
 10 11  1  0
 22 23  2  0
  5  6  2  0
 23 24  1  0
 11 12  2  0
 24 25  2  0
 25 20  1  0
 18 26  1  0
 12 14  1  0
 13  9  1  0
 13 14  2  0
  6  1  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 18  1  0
M  END

Alternative Forms

Associated Targets(Human)

MAP2K5 Tchem Dual specificity mitogen-activated protein kinase kinase 5 (650 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 381.52Molecular Weight (Monoisotopic): 381.2205AlogP: 6.35#Rotatable Bonds: 6
Polar Surface Area: 29.85Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.04CX LogP: 6.13CX LogD: 6.11
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.42Np Likeness Score: -0.50

References

1. Flaherty PT, Chopra I, Jain P, Yi S, Allen E, Cavanaugh J..  (2010)  Identification of benzimidazole-based inhibitors of the mitogen activated kinase-5 signaling pathway.,  20  (9): [PMID:20382528] [10.1016/j.bmcl.2010.03.033]

Source