The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 2-(3-stearoyl-1H-pyrazole-5-carboxamido)benzoate ID: ALA1098845
PubChem CID: 46888363
Max Phase: Preclinical
Molecular Formula: C30H45N3O4
Molecular Weight: 511.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCCC(=O)c1cc(C(=O)Nc2ccccc2C(=O)OC)[nH]n1
Standard InChI: InChI=1S/C30H45N3O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-28(34)26-23-27(33-32-26)29(35)31-25-21-19-18-20-24(25)30(36)37-2/h18-21,23H,3-17,22H2,1-2H3,(H,31,35)(H,32,33)
Standard InChI Key: QJUGOOPECIZKFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
0.6289 0.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0385 0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8474 0.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4708 -0.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2549 -0.9623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2567 0.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1936 1.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5330 1.7562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6766 0.3317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5033 0.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9167 1.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7426 1.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1572 0.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7400 -0.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9154 -0.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5006 -1.0978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9127 -1.8145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6739 -1.0962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7394 -1.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9683 -0.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6823 0.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3963 -0.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1102 0.0720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8242 -0.3372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5382 0.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2522 -0.3331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9661 0.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6801 -0.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3941 0.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1081 -0.3247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8220 0.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5360 -0.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2500 0.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9640 -0.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6780 0.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1742 1.5384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9280 1.2030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
1 2 2 0
16 18 2 0
7 8 2 0
17 19 1 0
2 3 1 0
6 20 1 0
7 9 1 0
20 21 1 0
3 37 2 0
21 22 1 0
9 10 1 0
22 23 1 0
23 24 1 0
10 11 2 0
24 25 1 0
25 26 1 0
11 12 1 0
26 27 1 0
3 4 1 0
27 28 1 0
12 13 2 0
28 29 1 0
4 5 2 0
29 30 1 0
13 14 1 0
30 31 1 0
4 6 1 0
31 32 1 0
14 15 2 0
32 33 1 0
15 10 1 0
33 34 1 0
34 35 1 0
15 16 1 0
1 7 1 0
37 36 1 0
36 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.71Molecular Weight (Monoisotopic): 511.3410AlogP: 7.89#Rotatable Bonds: 20Polar Surface Area: 101.15Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.53CX Basic pKa: ┄CX LogP: 9.26CX LogD: 9.02Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.11Np Likeness Score: -0.69
References 1. Chen HJ, Liu Y, Wang LN, Shen Q, Li J, Nan FJ.. (2010) Discovery and structural optimization of pyrazole derivatives as novel inhibitors of Cdc25B., 20 (9): [PMID:20363629 ] [10.1016/j.bmcl.2010.03.040 ]