1-(4-((1H-benzo[d]imidazol-2-yl)methyl)-1,4-diazepan-1-yl)-2-(2-(trifluoromethyl)phenylamino)ethanone

ID: ALA1098851

PubChem CID: 46887855

Max Phase: Preclinical

Molecular Formula: C22H24F3N5O

Molecular Weight: 431.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CNc1ccccc1C(F)(F)F)N1CCCN(Cc2nc3ccccc3[nH]2)CC1

Standard InChI:  InChI=1S/C22H24F3N5O/c23-22(24,25)16-6-1-2-7-17(16)26-14-21(31)30-11-5-10-29(12-13-30)15-20-27-18-8-3-4-9-19(18)28-20/h1-4,6-9,26H,5,10-15H2,(H,27,28)

Standard InChI Key:  YOBOIEILBMDGIV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -3.6050   -4.8608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6087   -5.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8942   -6.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8947   -4.4467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1828   -4.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1779   -5.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9000   -5.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3909   -4.6003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0734   -5.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3866   -5.9535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2114   -5.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7951   -6.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0289   -6.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7441   -7.2223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2737   -7.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0595   -7.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4579   -7.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1748   -7.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6016   -7.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3160   -7.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0263   -7.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0263   -6.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3105   -5.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6018   -6.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8909   -7.6395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4579   -8.4613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3160   -8.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4834   -8.4721    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.1326   -8.4721    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.3160   -9.2989    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3927   -5.9381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 10 13  1  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  1  0
 14 17  1  0
  1  2  2  0
 17 18  1  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 19 25  1  0
 25 18  1  0
  7  8  2  0
 17 26  2  0
  8  5  1  0
 20 27  1  0
  7  9  1  0
 27 28  1  0
  9 10  1  0
 27 29  1  0
 10 11  1  0
 27 30  1  0
 11 12  1  0
  6 31  1  0
 31  7  1  0
M  END

Associated Targets(Human)

CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.46Molecular Weight (Monoisotopic): 431.1933AlogP: 3.73#Rotatable Bonds: 5
Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.48CX Basic pKa: 6.16CX LogP: 2.43CX LogD: 2.41
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: -2.10

References

1. Gu SJ, Lee JK, Pae AN, Chung HJ, Rhim H, Han SY, Min SJ, Cho YS..  (2010)  Synthesis and biological evaluation of 1,4-diazepane derivatives as T-type calcium channel blockers.,  20  (9): [PMID:20382529] [10.1016/j.bmcl.2010.03.084]

Source