2-[2-amino-phenyl]-3a,4,9,9a-tetrahydro-4,9-benzeno-benz[f]isoindole-1,3-dione

ID: ALA1098902

PubChem CID: 21205128

Max Phase: Preclinical

Molecular Formula: C24H18N2O2

Molecular Weight: 366.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ccccc1N1C(=O)C2C3c4ccccc4C(c4ccccc43)C2C1=O

Standard InChI:  InChI=1S/C24H18N2O2/c25-17-11-5-6-12-18(17)26-23(27)21-19-13-7-1-2-8-14(13)20(22(21)24(26)28)16-10-4-3-9-15(16)19/h1-12,19-22H,25H2

Standard InChI Key:  UEJUFRKRCLMBAK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 33  0  0  0  0  0  0  0  0999 V2000
   13.7797   -6.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7834   -7.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6217   -6.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1077   -5.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7719   -5.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9505   -5.1172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4659   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8044   -6.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1129   -8.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6265   -7.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8062   -7.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4715   -8.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9631   -9.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7815   -9.0179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5627   -6.6898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5714   -7.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3587   -7.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8366   -7.0889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3446   -6.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5881   -5.6488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6187   -8.5338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6516   -7.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0629   -7.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8771   -7.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2779   -7.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8585   -6.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0457   -6.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6608   -8.4933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
 13 14  2  0
 14  9  1  0
  1 10  1  0
  3  2  1  0
 15 16  1  0
  9  2  1  0
  6  7  1  0
  2 16  1  0
  7  8  2  0
  8  3  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 19 20  2  0
  3  4  2  0
 17 21  2  0
  9 10  2  0
 18 22  1  0
  1  4  1  0
 22 23  2  0
 10 11  1  0
 23 24  1  0
  4  5  1  0
 24 25  2  0
 11 12  2  0
 25 26  1  0
 15  1  1  0
 26 27  2  0
 27 22  1  0
 12 13  1  0
 23 28  1  0
M  END

Associated Targets(non-human)

Bacillus thuringiensis (718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.42Molecular Weight (Monoisotopic): 366.1368AlogP: 3.67#Rotatable Bonds: 1
Polar Surface Area: 63.40Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.63CX LogP: 3.20CX LogD: 3.20
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: -0.35

References

1. Khalil AM, Berghot MA, Gouda MA..  (2010)  Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents.,  45  (4): [PMID:20117862] [10.1016/j.ejmech.2009.12.064]

Source