N-[2-(1,3-dioxo-1,3,3a,4,9,9a-hexahydro-4,9-benzeno-benz[f]isoindol-2-yl)-phenyl]-acetamide

ID: ALA1098903

PubChem CID: 46193508

Max Phase: Preclinical

Molecular Formula: C26H20N2O3

Molecular Weight: 408.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccccc1N1C(=O)C2C3c4ccccc4C(c4ccccc43)C2C1=O

Standard InChI:  InChI=1S/C26H20N2O3/c1-14(29)27-19-12-6-7-13-20(19)28-25(30)23-21-15-8-2-3-9-16(15)22(24(23)26(28)31)18-11-5-4-10-17(18)21/h2-13,21-24H,1H3,(H,27,29)

Standard InChI Key:  RXBPOECJGWJGFO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 36  0  0  0  0  0  0  0  0999 V2000
   -1.0798  -13.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0761  -14.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2380  -13.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7520  -12.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0877  -12.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9093  -11.9361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3941  -12.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0556  -13.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7467  -15.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2333  -14.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0536  -14.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3884  -15.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8968  -15.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0781  -15.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2966  -13.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2879  -14.3342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4996  -14.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9776  -13.9082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4854  -13.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7291  -12.4679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7596  -15.3535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7927  -13.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042  -14.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0186  -14.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4195  -13.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9999  -13.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1869  -13.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8021  -15.3130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2150  -16.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8128  -16.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0302  -16.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  3  2  1  0
 15 16  1  0
  9  2  1  0
  6  7  1  0
  2 16  1  0
  7  8  2  0
  8  3  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 19 20  2  0
  3  4  2  0
 17 21  2  0
  9 10  2  0
 18 22  1  0
  1  4  1  0
 22 23  2  0
 10 11  1  0
 23 24  1  0
  4  5  1  0
 24 25  2  0
 11 12  2  0
 25 26  1  0
 15  1  1  0
 26 27  2  0
 27 22  1  0
 12 13  1  0
 23 28  1  0
  5  6  2  0
 28 29  1  0
 13 14  2  0
 29 30  1  0
 14  9  1  0
 29 31  2  0
M  END

Associated Targets(non-human)

Bacillus thuringiensis (718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.46Molecular Weight (Monoisotopic): 408.1474AlogP: 4.04#Rotatable Bonds: 2
Polar Surface Area: 66.48Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.84CX Basic pKa: CX LogP: 3.26CX LogD: 3.26
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: -0.66

References

1. Khalil AM, Berghot MA, Gouda MA..  (2010)  Synthesis and study of some new 1,3-isoindoledione derivatives as potential antibacterial agents.,  45  (4): [PMID:20117862] [10.1016/j.ejmech.2009.12.064]

Source