The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(9-Phenylpropyl-b-carboline-3-carbonyl)-L-methionine ethylester ID: ALA1098928
PubChem CID: 46192728
Max Phase: Preclinical
Molecular Formula: C28H31N3O3S
Molecular Weight: 489.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)[C@H](CCSC)NC(=O)c1cc2c3ccccc3n(CCCc3ccccc3)c2cn1
Standard InChI: InChI=1S/C28H31N3O3S/c1-3-34-28(33)23(15-17-35-2)30-27(32)24-18-22-21-13-7-8-14-25(21)31(26(22)19-29-24)16-9-12-20-10-5-4-6-11-20/h4-8,10-11,13-14,18-19,23H,3,9,12,15-17H2,1-2H3,(H,30,32)/t23-/m0/s1
Standard InChI Key: LQMMILPBIJWTCB-QHCPKHFHSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
5.5844 -24.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8598 -25.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6051 -24.0058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4721 -21.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9771 -22.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3038 -23.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2896 -21.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6190 -22.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1257 -23.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3986 -22.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3923 -23.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1054 -24.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8251 -23.7698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8273 -22.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1137 -22.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5428 -22.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2563 -22.9417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5447 -21.7026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9717 -22.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6852 -22.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9737 -21.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4007 -22.5343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6833 -23.7701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1142 -22.9484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8433 -26.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1208 -26.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4147 -26.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6990 -26.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6826 -27.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3869 -27.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1060 -27.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6891 -21.2951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1122 -23.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6910 -20.4701 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.4065 -20.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
4 5 2 0
16 18 2 0
9 3 1 0
17 19 1 0
3 11 1 0
19 20 1 0
10 8 1 0
19 21 1 1
1 3 1 0
20 22 1 0
5 6 1 0
20 23 2 0
10 11 2 0
22 24 1 0
6 9 2 0
25 2 1 0
11 12 1 0
25 26 1 0
1 2 1 0
26 27 2 0
12 13 2 0
27 28 1 0
8 7 2 0
28 29 2 0
13 14 1 0
29 30 1 0
7 4 1 0
30 31 2 0
31 26 1 0
14 15 2 0
21 32 1 0
15 10 1 0
24 33 1 0
8 9 1 0
32 34 1 0
14 16 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.64Molecular Weight (Monoisotopic): 489.2086AlogP: 5.24#Rotatable Bonds: 11Polar Surface Area: 73.22Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.92CX LogP: 5.22CX LogD: 5.22Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -0.89
References 1. Ma C, Cao R, Shi B, Li S, Chen Z, Yi W, Peng W, Ren Z, Song H.. (2010) Synthesis and cytotoxic evaluation of N2-benzylated quaternary beta-carboline amino acid ester conjugates., 45 (4): [PMID:20122764 ] [10.1016/j.ejmech.2009.12.060 ]