(4S,5R,7S,8S,9S,11R)-8,11-epoxy-7-hydroxy-11-methoxydihyronepetalactone

ID: ALA1099264

PubChem CID: 46886744

Max Phase: Preclinical

Molecular Formula: C11H16O5

Molecular Weight: 228.24

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: jatamanin H | JATAMANIN H|CHEMBL1099264

Canonical SMILES:  CO[C@@H]1O[C@]2(C)[C@@H](O)C[C@@H]3[C@H]1COC(=O)[C@@H]32

Standard InChI:  InChI=1S/C11H16O5/c1-11-7(12)3-5-6(10(14-2)16-11)4-15-9(13)8(5)11/h5-8,10,12H,3-4H2,1-2H3/t5-,6-,7+,8-,10-,11-/m1/s1

Standard InChI Key:  NNNNBDAZLGGUIF-NHKRHKHHSA-N

Molfile:  

     RDKit          2D

 19 21  0  0  0  0  0  0  0  0999 V2000
   16.7317   -3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4436   -3.0640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4436   -2.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7317   -1.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0243   -3.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0243   -2.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2358   -1.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7518   -2.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2357   -3.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7317   -4.2924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9268   -2.6499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0174   -1.4092    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.5208   -3.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6438   -4.0265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3092   -2.6537    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.7415   -2.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8943   -2.5139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4558   -3.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6666   -1.0031    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  1 10  2  0
  4 16  1  0
  8 11  1  1
  6 12  1  1
  9 13  1  1
  9 14  1  0
  5 15  1  1
 14 16  1  0
 16 17  1  6
 17 18  1  0
  4 19  1  6
M  END

Alternative Forms

  1. Parent:

    ALA1099264

    JATAMANIN H

Associated Targets(Human)

A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-8 (3484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bel-7402 (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 228.24Molecular Weight (Monoisotopic): 228.0998AlogP: -0.08#Rotatable Bonds: 1
Polar Surface Area: 64.99Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.96CX Basic pKa: CX LogP: -0.10CX LogD: -0.10
Aromatic Rings: Heavy Atoms: 16QED Weighted: 0.64Np Likeness Score: 3.50

References

1. Lin S, Chen T, Liu XH, Shen YH, Li HL, Shan L, Liu RH, Xu XK, Zhang WD, Wang H..  (2010)  Iridoids and lignans from Valeriana jatamansi.,  73  (4): [PMID:20151678] [10.1021/np900795c]

Source