4-{2-(2-Carboxy-ethyl)-3-[6-(4,4''-dimethoxy-[1.1':3',1'']terphenyl-5'-yloxy)-hexyl]-phenoxy}-butyric acid

ID: ALA1099325

PubChem CID: 46888196

Max Phase: Preclinical

Molecular Formula: C39H44O8

Molecular Weight: 640.77

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc(OCCCCCCc3cccc(OCCCC(=O)O)c3CCC(=O)O)cc(-c3ccc(OC)cc3)c2)cc1

Standard InChI:  InChI=1S/C39H44O8/c1-44-33-17-13-28(14-18-33)31-25-32(29-15-19-34(45-2)20-16-29)27-35(26-31)46-23-6-4-3-5-9-30-10-7-11-37(36(30)21-22-39(42)43)47-24-8-12-38(40)41/h7,10-11,13-20,25-27H,3-6,8-9,12,21-24H2,1-2H3,(H,40,41)(H,42,43)

Standard InChI Key:  UAUGYZPHKFIFDW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 47 50  0  0  0  0  0  0  0  0999 V2000
    6.7861  -12.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7849  -13.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4997  -13.4235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2162  -13.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2133  -12.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4979  -11.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9313  -13.4216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6451  -13.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3602  -13.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0740  -13.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7892  -13.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5030  -13.0035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7905  -14.2421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4995  -14.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2139  -14.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2137  -15.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9281  -15.8989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4991  -15.8985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0701  -13.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3560  -13.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6412  -13.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9270  -13.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2122  -13.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4981  -13.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7833  -13.4192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0691  -13.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0709  -12.1820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3562  -13.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3577  -13.4196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3582  -12.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3585  -11.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3580  -10.9503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0748  -10.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0767   -9.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3624   -9.3009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3552   -9.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3535  -10.5394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0668  -13.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7827  -13.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4956  -13.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4937  -14.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7731  -14.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0632  -14.2496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3628   -8.4759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0774   -8.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2065  -14.6708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9227  -14.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
  6  1  1  0
 25 26  1  0
 11 13  2  0
 26 27  2  0
 27 31  1  0
  1  2  2  0
 30 28  1  0
  3 14  1  0
 28 29  2  0
 29 26  1  0
  4  7  1  0
 14 15  1  0
 30 31  2  0
  3  4  2  0
 15 16  1  0
 32 33  2  0
  7  8  1  0
 33 34  1  0
 16 17  1  0
 34 35  2  0
 35 36  1  0
 16 18  2  0
 36 37  2  0
 37 32  1  0
 31 32  1  0
  8  9  1  0
  2 19  1  0
 38 39  2  0
  4  5  1  0
 39 40  1  0
 19 20  1  0
 40 41  2  0
  9 10  1  0
 41 42  1  0
 20 21  1  0
 42 43  2  0
 43 38  1  0
 28 38  1  0
  2  3  1  0
 35 44  1  0
 21 22  1  0
 44 45  1  0
 10 11  1  0
 41 46  1  0
 22 23  1  0
 46 47  1  0
M  END

Associated Targets(Human)

LTB4R Tchem Leukotriene B4 receptor 1 (1083 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 640.77Molecular Weight (Monoisotopic): 640.3036AlogP: 8.48#Rotatable Bonds: 20
Polar Surface Area: 111.52Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.12CX Basic pKa: CX LogP: 8.51CX LogD: 2.79
Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.09Np Likeness Score: -0.06

References

1. Goodnow RA, Hicks A, Sidduri A, Kowalczyk A, Dominique R, Qiao Q, Lou JP, Gillespie P, Fotouhi N, Tilley J, Cohen N, Choudhry S, Cavallo G, Tannu SA, Ventre JD, Lavelle D, Tare NS, Oh H, Lamb M, Kurylko G, Hamid R, Wright MB, Pamidimukkala A, Egan T, Gubler U, Hoffman AF, Wei X, Li YL, O'Neil J, Marcano R, Pozzani K, Molinaro T, Santiago J, Singer L, Hargaden M, Moore D, Catala AR, Chao LC, Hermann G, Venkat R, Mancebo H, Renzetti LM..  (2010)  Discovery of novel and potent leukotriene B4 receptor antagonists. Part 1.,  53  (9): [PMID:20380377] [10.1021/jm1001919]

Source