The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-cyano-N-(3-(4-(2-methoxyphenyl)piperazin-1-yl)propyl)isonicotinamidine ID: ALA1099374
PubChem CID: 46861870
Max Phase: Preclinical
Molecular Formula: C21H26N6O
Molecular Weight: 378.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(CCCN/C(=N\C#N)c2ccncc2)CC1
Standard InChI: InChI=1S/C21H26N6O/c1-28-20-6-3-2-5-19(20)27-15-13-26(14-16-27)12-4-9-24-21(25-17-22)18-7-10-23-11-8-18/h2-3,5-8,10-11H,4,9,12-16H2,1H3,(H,24,25)
Standard InChI Key: PCSRINCTRTWFDX-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-6.3152 -5.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3141 -6.7023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.5961 -7.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8797 -6.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8825 -5.8713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5979 -5.4622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1696 -5.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4536 -5.8659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1727 -4.6311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4598 -4.2160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7451 -3.8006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7407 -5.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0247 -5.8606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3117 -5.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5957 -5.8552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5947 -6.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1172 -7.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8326 -6.6826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8314 -5.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1149 -5.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5470 -7.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5430 -7.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2567 -8.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9721 -7.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9695 -7.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2553 -6.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2508 -5.8547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9631 -5.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13 14 1 0
5 7 1 0
14 15 1 0
15 16 1 0
3 4 2 0
7 8 1 0
7 9 2 0
4 5 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
9 10 1 0
18 21 1 0
2 3 1 0
21 22 2 0
10 11 3 0
22 23 1 0
5 6 2 0
23 24 2 0
8 12 1 0
24 25 1 0
6 1 1 0
25 26 2 0
26 21 1 0
12 13 1 0
26 27 1 0
1 2 2 0
27 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.48Molecular Weight (Monoisotopic): 378.2168AlogP: 2.12#Rotatable Bonds: 7Polar Surface Area: 76.78Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.72CX LogP: 1.82CX LogD: 1.33Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.34Np Likeness Score: -1.47
References 1. Fiorino F, Severino B, De Angelis F, Perissutti E, Magli E, Frecentese F, Esposito A, Massarelli P, Nencini C, Santagada V, Caliendo G.. (2010) New 5-HT(1A) receptor ligands containing a N'-cyanoisonicotinamidine nucleus: synthesis and in vitro pharmacological evaluation., 20 (9): [PMID:20347301 ] [10.1016/j.bmcl.2010.02.106 ]