(S)-2-[(S)-2-((S)-2-Acetylamino-3-hydroxy-propionylamino)-4-methyl-pentanoylamino]-3-methyl-butyric acid

ID: ALA110417

Cas Number: 189109-90-8

PubChem CID: 9209375

Max Phase: Preclinical

Molecular Formula: C16H29N3O6

Molecular Weight: 359.42

Molecule Type: Protein

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)O)C(C)C

Standard InChI:  InChI=1S/C16H29N3O6/c1-8(2)6-11(14(22)19-13(9(3)4)16(24)25)18-15(23)12(7-20)17-10(5)21/h8-9,11-13,20H,6-7H2,1-5H3,(H,17,21)(H,18,23)(H,19,22)(H,24,25)/t11-,12-,13-/m0/s1

Standard InChI Key:  ORIIRLCDJGETQD-AVGNSLFASA-N

Molfile:  

     RDKit          2D

 25 24  0  0  1  0  0  0  0  0999 V2000
    1.8125   -3.9667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2708   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2917   -3.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2542   -3.6667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7875   -3.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -3.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7667   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3083   -3.9667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8500   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8250   -3.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2708   -4.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2917   -3.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8500   -4.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7667   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8250   -3.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3667   -3.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7875   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2708   -2.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4667   -5.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3458   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8500   -2.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8125   -2.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1333   -5.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7542   -5.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  1  1  0
  4  7  1  0
  5  2  1  0
  6  1  1  0
  7  3  1  0
  8  5  1  0
  9  6  1  0
 10  8  1  0
 11  2  2  0
 12  3  2  0
 13  9  2  0
  7 14  1  6
 15 10  2  0
  6 16  1  1
 17  9  1  0
  5 18  1  1
 19 18  1  0
 20 14  1  0
 21 10  1  0
 22 16  1  0
 23 16  1  0
 24 20  1  0
 25 20  1  0
M  END

Associated Targets(Human)

PTPN13 Tchem Protein-tyrosine phosphatase 1E (88 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 359.42Molecular Weight (Monoisotopic): 359.2056AlogP: -0.76#Rotatable Bonds: 10
Polar Surface Area: 144.83Molecular Species: ACIDHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 3.97CX Basic pKa: CX LogP: -0.74CX LogD: -3.91
Aromatic Rings: Heavy Atoms: 25QED Weighted: 0.35Np Likeness Score: 0.27

References

1. Sawa E, Takahashi M, Kamishohara M, Tazunoki T, Kimura K, Arai M, Miyazaki T, Kataoka S, Nishitoba T..  (1999)  Structural modification of Fas C-terminal tripeptide and its effects on the inhibitory activity of Fas/FAP-1 binding.,  42  (17): [PMID:10464015] [10.1021/jm980617f]
2. He, Yantao Y and 11 more authors.  2013-06-27  A potent and selective small-molecule inhibitor for the lymphoid-specific tyrosine phosphatase (LYP), a target associated with autoimmune diseases.  [PMID:23713581]

Source