The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[2-(3,4-Dimethoxy-phenyl)-ethylamino]-3-[5-(5-thiophen-2-yl-1H-imidazol-2-yl)-pyridin-2-yloxy]-propan-2-ol ID: ALA11178
PubChem CID: 13621796
Max Phase: Preclinical
Molecular Formula: C25H28N4O4S
Molecular Weight: 480.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCNCC(O)COc2ccc(-c3nc(-c4cccs4)c[nH]3)cn2)cc1OC
Standard InChI: InChI=1S/C25H28N4O4S/c1-31-21-7-5-17(12-22(21)32-2)9-10-26-14-19(30)16-33-24-8-6-18(13-27-24)25-28-15-20(29-25)23-4-3-11-34-23/h3-8,11-13,15,19,26,30H,9-10,14,16H2,1-2H3,(H,28,29)
Standard InChI Key: CHGOMLLLZPHCNH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-1.5250 -1.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5083 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6875 -2.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2458 -1.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8500 -1.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7750 -1.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9125 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6542 -1.1500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4958 -3.8167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7750 -0.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6542 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0625 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7208 -3.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6042 -1.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0375 -4.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1500 -0.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7708 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7958 -4.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3667 0.0958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -1.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0583 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -0.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8000 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0792 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2125 -1.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5542 -0.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2292 0.0958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2292 -1.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8000 0.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5125 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9417 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6542 0.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1750 -0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -2.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 2 0
4 1 1 0
5 4 1 0
6 1 1 0
7 2 1 0
8 12 2 0
9 7 1 0
10 16 1 0
11 21 2 0
12 6 1 0
13 7 2 0
14 20 1 0
15 9 1 0
16 22 2 0
17 6 2 0
18 13 1 0
19 11 1 0
20 25 2 0
21 17 1 0
22 32 1 0
23 24 1 0
24 19 1 0
25 22 1 0
26 10 1 0
27 30 1 0
28 14 1 0
29 23 1 0
30 23 1 0
31 27 1 0
32 31 1 0
33 26 1 0
34 28 1 0
5 2 2 0
8 11 1 0
18 15 2 0
14 10 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.59Molecular Weight (Monoisotopic): 480.1831AlogP: 3.79#Rotatable Bonds: 12Polar Surface Area: 101.52Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.91CX Basic pKa: 9.31CX LogP: 3.61CX LogD: 1.71Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.27Np Likeness Score: -1.12
References 1. Baldwin JJ, Christy ME, Denny GH, Habecker CN, Freedman MB, Lyle PA, Ponticello GS, Varga SL, Gross DM, Sweet CS.. (1986) Beta 1-selective adrenoceptor antagonists: examples of the 2-[4-[3-(substituted amino)-2-hydroxypropoxy]phenyl]imidazole class. 2., 29 (6): [PMID:2872332 ] [10.1021/jm00156a028 ]