(8-Methoxy-4-o-tolylamino-quinolin-3-yl)-phenyl-methanone

ID: ALA115239

Cas Number: 115607-64-2

PubChem CID: 9999104

Max Phase: Preclinical

Molecular Formula: C24H20N2O2

Molecular Weight: 368.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc2c(Nc3ccccc3C)c(C(=O)c3ccccc3)cnc12

Standard InChI:  InChI=1S/C24H20N2O2/c1-16-9-6-7-13-20(16)26-22-18-12-8-14-21(28-2)23(18)25-15-19(22)24(27)17-10-4-3-5-11-17/h3-15H,1-2H3,(H,25,26)

Standard InChI Key:  QGFLHWNLAOUSPQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    4.5042   -5.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2167   -5.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7917   -5.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5042   -4.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5000   -7.1250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9292   -5.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7875   -6.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2167   -6.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7917   -4.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9375   -4.6542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0792   -7.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6417   -5.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0792   -5.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0792   -7.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -5.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0792   -4.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -6.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6417   -6.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3542   -5.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5167   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0875   -2.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -8.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -4.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3542   -7.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0667   -5.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -3.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0667   -6.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  1  1  0
  5  7  2  0
  6  2  1  0
  7  3  1  0
  8  2  2  0
  9  4  1  0
 10  6  2  0
 11  7  1  0
 12  6  1  0
 13  9  2  0
 14  3  1  0
 15 11  1  0
 16 14  2  0
 17  9  1  0
 18 16  1  0
 19 12  2  0
 20 12  1  0
 21 13  1  0
 22 13  1  0
 23 15  1  0
 24 17  2  0
 25 19  1  0
 26 20  2  0
 27 24  1  0
 28 26  1  0
  5  8  1  0
 18 11  2  0
 27 22  2  0
 28 25  2  0
M  END

Alternative Forms

Associated Targets(non-human)

ATP4B Potassium-transporting ATPase (475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.44Molecular Weight (Monoisotopic): 368.1525AlogP: 5.53#Rotatable Bonds: 5
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.46CX LogP: 6.69CX LogD: 6.69
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: -1.04

References

1. Ife RJ, Brown TH, Keeling DJ, Leach CA, Meeson ML, Parsons ME, Reavill DR, Theobald CJ, Wiggall KJ..  (1992)  Reversible inhibitors of the gastric (H+/K+)-ATPase. 3. 3-substituted-4-(phenylamino)quinolines.,  35  (18): [PMID:1326634] [10.1021/jm00096a018]

Source