The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Nitro-benzoic acid 4-(5-benzyloxycarbonylamino-6-oxo-2-phenyl-6H-pyrimidin-1-yl)-2-methoxycarbonyl-but-2-enyl ester ID: ALA115685
PubChem CID: 10974029
Max Phase: Preclinical
Molecular Formula: C31H26N4O9
Molecular Weight: 598.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)/C(=C/Cn1c(-c2ccccc2)ncc(NC(=O)OCc2ccccc2)c1=O)COC(=O)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C31H26N4O9/c1-42-29(37)24(20-43-30(38)23-12-14-25(15-13-23)35(40)41)16-17-34-27(22-10-6-3-7-11-22)32-18-26(28(34)36)33-31(39)44-19-21-8-4-2-5-9-21/h2-16,18H,17,19-20H2,1H3,(H,33,39)/b24-16+
Standard InChI Key: QNBDEDUILFRPSS-LFVJCYFKSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
6.5417 -5.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1167 -5.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8292 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5375 -5.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8167 -4.6792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0292 -8.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6792 -6.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1042 -5.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -6.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2542 -6.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6875 -5.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9667 -5.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3917 -5.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9542 -8.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7250 -8.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6250 -8.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4042 -7.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8292 -7.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7417 -9.3917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6875 -7.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1042 -8.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2500 -4.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6792 -5.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3917 -5.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4417 -9.0375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9750 -6.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0125 -8.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -9.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -7.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8250 -9.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1125 -6.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2542 -5.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5417 -6.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2417 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9625 -5.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8250 -5.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8292 -5.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5417 -7.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9500 -3.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6750 -4.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -6.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8292 -7.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -7.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6667 -3.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 1 1 0
5 4 2 0
6 15 1 0
7 12 2 0
8 5 1 0
9 2 1 0
10 1 1 0
11 9 1 0
12 10 1 0
13 7 1 0
14 17 1 0
15 28 1 0
16 6 1 0
17 20 1 0
18 3 2 0
19 6 2 0
20 7 1 0
21 14 1 0
22 4 1 0
23 11 2 0
24 13 2 0
25 14 2 0
26 11 1 0
27 29 1 0
28 30 2 0
29 21 2 0
30 21 1 0
31 13 1 0
32 26 1 0
33 32 1 0
34 22 1 0
35 22 2 0
36 31 1 0
37 33 2 0
38 33 1 0
39 34 2 0
40 35 1 0
41 37 1 0
42 38 2 0
43 42 1 0
44 40 2 0
8 2 2 0
39 44 1 0
27 15 2 0
41 43 2 0
M CHG 2 6 1 16 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.57Molecular Weight (Monoisotopic): 598.1700AlogP: 4.52#Rotatable Bonds: 11Polar Surface Area: 168.96Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.19CX Basic pKa: 0.26CX LogP: 4.93CX LogD: 4.93Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.09Np Likeness Score: -0.65
References 1. Zhu S, Hudson TH, Kyle DE, Lin AJ.. (2002) Synthesis and in vitro studies of novel pyrimidinyl peptidomimetics as potential antimalarial therapeutic agents., 45 (16): [PMID:12139460 ] [10.1021/jm020104f ]