The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,5-dihydroxy-3,6-di(3,4,5-trihydroxyphenylcarbonyloxy)-2-(3,4,5-trihydroxyphenylcarbonyloxymethyl)tetrahydro-2H-pyran ID: ALA1159462
PubChem CID: 10349127
Max Phase: Preclinical
Molecular Formula: C27H24O18
Molecular Weight: 636.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(OC[C@H]1O[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1
Standard InChI: InChI=1S/C27H24O18/c28-11-1-8(2-12(29)18(11)34)24(39)42-7-17-23(44-25(40)9-3-13(30)19(35)14(31)4-9)21(37)22(38)27(43-17)45-26(41)10-5-15(32)20(36)16(33)6-10/h1-6,17,21-23,27-38H,7H2/t17-,21-,22-,23-,27-/m1/s1
Standard InChI Key: SUAXOYITDJNGFM-HDCOVYJKSA-N
Molfile:
RDKit 2D
45 48 0 0 0 0 0 0 0 0999 V2000
-9.8625 4.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5770 4.8429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.2915 4.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.2915 3.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5770 3.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8625 3.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0060 4.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7204 4.4304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.0060 3.1928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.5770 2.3679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1481 3.1929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-13.4349 4.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.1494 4.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.4349 5.6679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.8639 4.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5783 4.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5783 3.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.8638 3.1928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.1494 3.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1481 4.8429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.4336 4.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7191 4.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4336 3.6054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.0046 4.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2902 4.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2902 5.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0047 6.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7191 5.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0047 6.9054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5757 6.0804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5757 4.4303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.3323 2.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.1556 2.5528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-16.2928 4.8429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-16.2928 3.1929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.8638 2.3678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.3323 1.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0468 1.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0468 0.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.3323 0.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6178 0.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6178 1.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9034 0.0249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.3323 -0.8001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-13.7613 0.0249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
6 1 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 1
7 8 1 0
4 9 1 6
5 10 1 1
6 11 1 6
8 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
13 19 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
1 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
22 28 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
27 29 1 0
26 30 1 0
25 31 1 0
32 9 1 0
32 33 2 0
16 34 1 0
17 35 1 0
18 36 1 0
32 37 1 0
37 38 1 0
37 42 2 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
41 43 1 0
40 44 1 0
39 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 636.47Molecular Weight (Monoisotopic): 636.0963AlogP: -0.28#Rotatable Bonds: 7Polar Surface Area: 310.66Molecular Species: NEUTRALHBA: 18HBD: 11#RO5 Violations: 3HBA (Lipinski): 18HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.67CX Basic pKa: ┄CX LogP: 1.82CX LogD: 1.59Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.09Np Likeness Score: 1.10
References 1. Kashiwada Y, Nonaka G, Nishioka I, Ballas LM, Jiang JB, Janzen WP, Lee K. (1992) Tannins as selective inhibitors of protein kinase C, 2 (3): [10.1016/S0960-894X(01)81072-6 ]