The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Acetic acid 2-acetoxy-1-(3,4,5-trihydroxy-6-sulfomethyl-tetrahydro-pyran-2-yloxymethyl)-ethyl ester ID: ALA1159523
PubChem CID: 46905180
Max Phase: Preclinical
Molecular Formula: C13H22O12S
Molecular Weight: 402.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OCC(CO[C@H]1O[C@H](CS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]1O)OC(C)=O
Standard InChI: InChI=1S/C13H22O12S/c1-6(14)22-3-8(24-7(2)15)4-23-13-12(18)11(17)10(16)9(25-13)5-26(19,20)21/h8-13,16-18H,3-5H2,1-2H3,(H,19,20,21)/t8?,9-,10-,11+,12-,13+/m1/s1
Standard InChI Key: QYDUPKWHIDQOGZ-NSIFWNNTSA-N
Molfile:
RDKit 2D
26 26 0 0 0 0 0 0 0 0999 V2000
6.2243 5.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5098 5.4804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7953 5.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7953 4.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5098 3.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2243 4.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9388 5.4804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9388 3.8304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5098 3.0054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0809 3.8303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0809 5.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3664 5.0679 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.6519 5.4804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7789 4.3534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7830 4.4845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6532 5.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3677 5.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0822 5.0679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3677 6.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6532 6.7179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6532 7.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9388 7.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3677 7.9554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7967 5.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5111 5.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7967 6.3054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
6 1 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 6
6 8 1 6
5 9 1 1
4 10 1 6
3 11 1 1
11 12 1 0
12 13 2 0
12 14 2 0
12 15 1 0
7 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
18 24 1 0
24 25 1 0
24 26 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.37Molecular Weight (Monoisotopic): 402.0832AlogP: -2.81#Rotatable Bonds: 8Polar Surface Area: 186.12Molecular Species: ACIDHBA: 11HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: -1.22CX Basic pKa: ┄CX LogP: -3.02CX LogD: -5.39Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.24Np Likeness Score: 1.69
References 1. Kurihara H, Ando J, Hatano M, Kawabata J. (1995) Sulfoquinovosyldiacylglycerol as an -glucosidase inhibitor, 5 (12): [10.1016/0960-894X(95)00196-Z ]