The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[14-Hydroxy-10,13-dimethyl-3-(3,4,5-trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-yloxy)-hexadecahydro-cyclopenta[a]phenanthren-17-yl]-5H-furan-2-one ID: ALA1159613
PubChem CID: 46905254
Max Phase: Preclinical
Molecular Formula: C29H44O9
Molecular Weight: 536.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC12CCC(O[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)CC1CCC1C2CC[C@]2(C)C(C3=CC(=O)OC3)CCC12O
Standard InChI: InChI=1S/C29H44O9/c1-27-8-5-17(37-26-25(34)24(33)23(32)21(13-30)38-26)12-16(27)3-4-20-19(27)6-9-28(2)18(7-10-29(20,28)35)15-11-22(31)36-14-15/h11,16-21,23-26,30,32-35H,3-10,12-14H2,1-2H3/t16?,17?,18?,19?,20?,21-,23+,24+,25-,26+,27?,28-,29?/m1/s1
Standard InChI Key: CMHWMOGWFZWDMR-YYFQVYEJSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-8.2192 3.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5047 3.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5047 4.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2192 5.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9336 4.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9336 3.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7902 5.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0757 4.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0757 3.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7902 3.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7903 5.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0758 6.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3613 5.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3613 5.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5767 4.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0918 5.4787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5767 6.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3613 6.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3218 6.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5372 7.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5372 8.0106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3218 8.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8067 7.5982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5767 9.0502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3613 4.2412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5047 5.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6481 3.4161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.6481 2.5911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4450 2.8046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.0284 2.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.8149 1.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0180 1.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4346 1.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.8253 2.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.4086 1.8514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.3982 0.8410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.8045 0.4139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.6377 1.5807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 1 1 0
10 2 1 0
2 3 1 0
3 7 1 0
8 9 1 0
9 10 1 0
14 8 1 0
8 7 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
13 18 1 1
17 19 1 0
19 20 1 0
19 23 2 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
14 25 1 0
3 26 1 0
6 27 1 0
28 27 1 6
28 29 1 0
33 28 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
30 34 1 1
34 35 1 0
31 36 1 1
32 37 1 1
33 38 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.66Molecular Weight (Monoisotopic): 536.2985AlogP: 1.43#Rotatable Bonds: 4Polar Surface Area: 145.91Molecular Species: NEUTRALHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.18CX Basic pKa: 0.24CX LogP: 1.30CX LogD: 0.87Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: 3.02
References 1. Rathore H, From AH, Ahmed K, Fullerton DS.. (1986) Cardiac glycosides. 7. Sugar stereochemistry and cardiac glycoside activity., 29 (10): [PMID:3020248 ] [10.1021/jm00160a025 ] 2. Rathore H, From AH, Ahmed K, Fullerton DS.. (1986) Cardiac glycosides. 7. Sugar stereochemistry and cardiac glycoside activity., 29 (10): [PMID:3020248 ] [10.1021/jm00160a025 ]