2-{2-[Bis-(2-chloro-ethyl)-amino]-3-methyl-2-oxo-2lambda*5*-[1,3,2]oxazaphosphinan-4-ylsulfanyl}-ethanesulfonic acid anion

ID: ALA1160092

PubChem CID: 10001873

Max Phase: Preclinical

Molecular Formula: C10H21Cl2N2O5PS2

Molecular Weight: 415.30

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1C(SCCS(=O)(=O)O)CCOP1(=O)N(CCCl)CCCl

Standard InChI:  InChI=1S/C10H21Cl2N2O5PS2/c1-13-10(21-8-9-22(16,17)18)2-7-19-20(13,15)14(5-3-11)6-4-12/h10H,2-9H2,1H3,(H,16,17,18)

Standard InChI Key:  KHCFJAOIAZNBJC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 22  0  0  0  0  0  0  0  0999 V2000
    6.1292   -2.8292    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    5.7167   -2.1167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -1.3667    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.8917   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -3.2417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7042   -3.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7042   -2.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5417   -0.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9167   -2.1542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3292   -1.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4792   -2.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -1.5167    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.9292   -1.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8792   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4167   -2.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9417   -4.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5042   -1.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7917   -2.2792    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.8167   -5.1917    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.7042   -4.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2167   -2.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  8  1  0
  4  2  1  0
  5  1  1  0
  6  1  1  0
  7  1  2  0
  8 18  1  0
  9  3  1  0
 10  3  2  0
 11  3  2  0
 12 15  1  0
 13  4  1  0
 14  2  1  0
 15  6  1  0
 16  5  1  0
 17  5  1  0
 18 13  1  0
 19 22  1  0
 20 21  1  0
 21 17  1  0
 22 16  1  0
 12  4  1  0
M  END

Associated Targets(non-human)

NIH3T3 (5395 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.30Molecular Weight (Monoisotopic): 414.0007AlogP: 2.17#Rotatable Bonds: 9
Polar Surface Area: 87.15Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: -0.83CX Basic pKa: 0.16CX LogP: -0.59CX LogD: -2.10
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.35Np Likeness Score: -0.13

References

1. Moon KY, Kwon CH..  (1998)  N3-methyl-mafosfamide as a chemically stable, alternative prodrug of mafosfamide.,  (13): [PMID:9873412] [10.1016/s0960-894x(98)00287-x]

Source