The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{2-[Bis-(2-chloro-ethyl)-amino]-3-methyl-2-oxo-2lambda*5*-[1,3,2]oxazaphosphinan-4-ylsulfanyl}-ethanesulfonic acid anion ID: ALA1160092
PubChem CID: 10001873
Max Phase: Preclinical
Molecular Formula: C10H21Cl2N2O5PS2
Molecular Weight: 415.30
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1C(SCCS(=O)(=O)O)CCOP1(=O)N(CCCl)CCCl
Standard InChI: InChI=1S/C10H21Cl2N2O5PS2/c1-13-10(21-8-9-22(16,17)18)2-7-19-20(13,15)14(5-3-11)6-4-12/h10H,2-9H2,1H3,(H,16,17,18)
Standard InChI Key: KHCFJAOIAZNBJC-UHFFFAOYSA-N
Molfile:
RDKit 2D
22 22 0 0 0 0 0 0 0 0999 V2000
6.1292 -2.8292 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.7167 -2.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1292 -1.3667 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.8917 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -3.2417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7042 -3.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7042 -2.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9167 -1.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5417 -0.7792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9167 -2.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3292 -1.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4792 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3042 -1.5167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.9292 -1.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 -3.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4167 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9417 -4.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5042 -1.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7917 -2.2792 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.8167 -5.1917 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -4.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2167 -2.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 8 1 0
4 2 1 0
5 1 1 0
6 1 1 0
7 1 2 0
8 18 1 0
9 3 1 0
10 3 2 0
11 3 2 0
12 15 1 0
13 4 1 0
14 2 1 0
15 6 1 0
16 5 1 0
17 5 1 0
18 13 1 0
19 22 1 0
20 21 1 0
21 17 1 0
22 16 1 0
12 4 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.30Molecular Weight (Monoisotopic): 414.0007AlogP: 2.17#Rotatable Bonds: 9Polar Surface Area: 87.15Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: -0.83CX Basic pKa: 0.16CX LogP: -0.59CX LogD: -2.10Aromatic Rings: ┄Heavy Atoms: 22QED Weighted: 0.35Np Likeness Score: -0.13