The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-Benzyl-thioureido)-3-{2-[(S)-4-(3-guanidino-propyl)-2,5-dioxo-imidazolidin-1-yl]-acetylamino}-propionic acid anion ID: ALA1160215
PubChem CID: 44296682
Max Phase: Preclinical
Molecular Formula: C20H28N8O5S
Molecular Weight: 492.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H]1NC(=O)N(CC(=O)NCC(/N=C(\S)NCc2ccccc2)C(=O)O)C1=O
Standard InChI: InChI=1S/C20H28N8O5S/c21-18(22)23-8-4-7-13-16(30)28(20(33)27-13)11-15(29)24-10-14(17(31)32)26-19(34)25-9-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2,(H,24,29)(H,27,33)(H,31,32)(H4,21,22,23)(H2,25,26,34)/t13-,14?/m0/s1
Standard InChI Key: CEYQEAWYRXDCAO-LSLKUGRBSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
3.4750 -2.6292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2167 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -2.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3917 -3.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1292 -2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0500 -2.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4500 -3.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2250 -2.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6667 -3.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2625 -2.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3708 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8667 -2.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7000 -4.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3708 -1.9875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8000 -1.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6250 -2.4542 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0625 -3.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6542 -2.6750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2667 -3.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0042 -1.9042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -1.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7000 -3.7375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6583 -3.2250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0875 -3.2250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8500 -3.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4542 -4.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3542 -2.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0458 -2.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2875 -4.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2417 -3.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7375 -2.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9042 -5.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8542 -4.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6875 -5.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 3 1 0
6 19 1 0
7 9 2 0
8 6 1 0
9 6 1 0
10 1 1 0
11 23 1 0
12 10 1 0
13 2 2 0
14 11 2 0
15 3 2 0
16 7 1 0
17 7 1 0
18 12 1 0
19 18 1 0
20 8 1 0
21 8 2 0
22 12 2 0
23 28 1 0
24 11 1 0
25 17 1 0
26 25 1 0
5 27 1 1
28 31 1 0
29 26 2 0
30 26 1 0
31 27 1 0
32 29 1 0
33 30 2 0
34 33 1 0
5 4 1 0
32 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.56Molecular Weight (Monoisotopic): 492.1903AlogP: -1.18#Rotatable Bonds: 12Polar Surface Area: 202.10Molecular Species: ZWITTERIONHBA: 6HBD: 8#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.23CX Basic pKa: 12.92CX LogP: -3.40CX LogD: -3.38Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.06Np Likeness Score: -0.58
References 1. Peyman A, Wehner V, Knolle J, Stilz HU, Breipohl G, Scheunemann KH, Carniato D, Ruxer JM, Gourvest JF, Gadek TR, Bodary S.. (2000) RGD mimetics containing a central hydantoin scaffold: alpkha(v)beta3 vs alpha(IIb)beta3 selectivity requirements., 10 (2): [PMID:10673106 ] [10.1016/s0960-894x(99)00661-7 ]