The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(Butane-1-sulfonylamino)-3-{2-[(S)-4-(3-guanidino-propyl)-2,5-dioxo-imidazolidin-1-yl]-acetylamino}-propionic acid anion ID: ALA1160219
PubChem CID: 44296697
Max Phase: Preclinical
Molecular Formula: C16H29N7O7S
Molecular Weight: 463.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCS(=O)(=O)NC(CNC(=O)CN1C(=O)N[C@@H](CCCN=C(N)N)C1=O)C(=O)O
Standard InChI: InChI=1S/C16H29N7O7S/c1-2-3-7-31(29,30)22-11(14(26)27)8-20-12(24)9-23-13(25)10(21-16(23)28)5-4-6-19-15(17)18/h10-11,22H,2-9H2,1H3,(H,20,24)(H,21,28)(H,26,27)(H4,17,18,19)/t10-,11?/m0/s1
Standard InChI Key: XGQDDTYGGROBPX-VUWPPUDQSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
2.8417 -2.0875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -2.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1750 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8167 -2.7250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7625 -2.8750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -2.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4167 -2.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0375 -2.9792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5917 -1.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6292 -1.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0000 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0667 -3.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4000 -2.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2292 -2.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0000 -1.4500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1667 -0.7792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0250 -2.1375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6375 -2.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3750 -1.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9750 -1.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0667 -3.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2875 -2.6875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7208 -2.6875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4292 -3.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7250 -1.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6750 -2.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2167 -3.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1042 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8292 -3.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6167 -3.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 8 1 0
5 2 1 0
6 3 1 0
7 19 1 0
8 7 1 0
9 7 1 0
10 1 1 0
11 23 2 0
12 10 1 0
13 2 2 0
14 4 2 0
15 4 2 0
16 11 1 0
17 3 2 0
18 12 1 0
19 18 1 0
20 9 1 0
21 9 2 0
22 12 2 0
23 27 1 0
24 11 1 0
25 4 1 0
6 26 1 1
27 29 1 0
28 25 1 0
29 26 1 0
30 28 1 0
31 30 1 0
6 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.52Molecular Weight (Monoisotopic): 463.1849AlogP: -2.75#Rotatable Bonds: 14Polar Surface Area: 226.38Molecular Species: ZWITTERIONHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.28CX Basic pKa: 11.58CX LogP: -4.69CX LogD: -4.69Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.07Np Likeness Score: -0.53
References 1. Peyman A, Wehner V, Knolle J, Stilz HU, Breipohl G, Scheunemann KH, Carniato D, Ruxer JM, Gourvest JF, Gadek TR, Bodary S.. (2000) RGD mimetics containing a central hydantoin scaffold: alpkha(v)beta3 vs alpha(IIb)beta3 selectivity requirements., 10 (2): [PMID:10673106 ] [10.1016/s0960-894x(99)00661-7 ]