2-Benzyloxycarbonylamino-3-{2-[(S)-4-(3-guanidino-propyl)-2,5-dioxo-imidazolidin-1-yl]-acetylamino}-propionic acid anion

ID: ALA1160220

PubChem CID: 10050710

Max Phase: Preclinical

Molecular Formula: C20H27N7O7

Molecular Weight: 477.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(N)NCCC[C@@H]1NC(=O)N(CC(=O)NCC(NC(=O)OCc2ccccc2)C(=O)O)C1=O

Standard InChI:  InChI=1S/C20H27N7O7/c21-18(22)23-8-4-7-13-16(29)27(19(32)25-13)10-15(28)24-9-14(17(30)31)26-20(33)34-11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2,(H,24,28)(H,25,32)(H,26,33)(H,30,31)(H4,21,22,23)/t13-,14?/m0/s1

Standard InChI Key:  UKUIUQNHAUNIMO-LSLKUGRBSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
    0.4167   -2.6292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1625   -3.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2500   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6625   -3.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9208   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9917   -2.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3917   -3.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1667   -2.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6125   -3.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2042   -2.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4250   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8125   -2.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6417   -4.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4250   -1.9875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2583   -1.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000   -2.6750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2125   -3.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -1.9042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5667   -2.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5500   -1.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042   -3.8125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6417   -3.7292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7125   -3.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1458   -3.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7917   -3.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4042   -4.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7000   -2.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1000   -2.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2292   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1875   -3.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3208   -2.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8500   -5.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8000   -4.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6292   -5.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  1  0
  6 17  1  0
  7  9  1  0
  8  6  1  0
  9  6  1  0
 10  1  1  0
 11 23  1  0
 12 10  1  0
 13  2  2  0
 14 11  2  0
 15  3  2  0
 16 12  1  0
 17 16  1  0
 18  8  1  0
 19  7  2  0
 20  8  2  0
 21  7  1  0
 22 12  2  0
 23 28  1  0
 24 11  1  0
 25 21  1  0
 26 25  1  0
  5 27  1  1
 28 31  1  0
 29 26  2  0
 30 26  1  0
 31 27  1  0
 32 29  1  0
 33 30  2  0
 34 33  1  0
  5  4  1  0
 32 34  2  0
M  END

Associated Targets(Human)

ITGB3 Tclin Integrin alpha-IIb/beta-3 (3481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 477.48Molecular Weight (Monoisotopic): 477.1972AlogP: -1.33#Rotatable Bonds: 12
Polar Surface Area: 216.04Molecular Species: ZWITTERIONHBA: 7HBD: 7
#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.42CX Basic pKa: 12.14CX LogP: -3.26CX LogD: -3.26
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.08Np Likeness Score: -0.50

References

1. Peyman A, Wehner V, Knolle J, Stilz HU, Breipohl G, Scheunemann KH, Carniato D, Ruxer JM, Gourvest JF, Gadek TR, Bodary S..  (2000)  RGD mimetics containing a central hydantoin scaffold: alpkha(v)beta3 vs alpha(IIb)beta3 selectivity requirements.,  10  (2): [PMID:10673106] [10.1016/s0960-894x(99)00661-7]

Source